| DFBP ID - DFBPOPIO0067(Opioid peptide) |
| DFBP ID |
DFBPOPIO0067 |
| Peptide sequence |
PLG |
| Type |
Native peptide |
| Peptide/Function name |
Opioid peptide, Gliadin 1 exorphin |
|
| Function-activity relationship |
| Main bioactivity |
Opioid activity |
| Otheir bioactivity |
ACE-inhibitory activity [D1], [D2], Multifunctional activity [D3] |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Pro-Leu-Gly |
| Single-letter amino acid |
PLG |
| Peptide length |
3 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| N.D |
285.34 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
5.97 c |
| IC50 |
N.D |
| pIC50 |
N.D |
| GRAVY |
0.6000 c |
| Hydrophilic residue ratio |
100% c |
| Peptide calculator |
|
|
| Biological/Functional activity & target protein |
| Opioid activity |
Chronic administration of either PLG (0.25 mg/kg, SC, BID) or the control substance, pareptide (0.25 mg/kg, SC, BID), antagonized the development of tolerance to the cataleptic effects of haloperidol in mice. PLG increased the in vitro binding of 3H-apomorphine to rat striatal receptors.
The effects of the peptide PLG on tolerance development and apomorphine binding are similar to those previously reported for MIF-1 and demonstrate that amidation at the carboxyl terminus is not required for biological activity.
|
| Specific target protein(s) |
N.D |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
Bitter taste prediction |
|
| SMILES |
N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O |
|
| Preparation method |
| Mode of preparation |
Synthesis
|
| Enzyme(s)/starter culture |
Synthesis peptide
|
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
|
|
| Additional information |
| Additional information |
N.D |
|
| Database cross-references |
|
|
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Mycroft FJ, Bhargava HN, Wei ET. Pharmacological activities of the MIF-1 analogues Pro-Leu-Gly, Tyr-Pro-Leu-Gly and pareptide. Peptides. 1987 Nov-Dec;8(6):1051-5.
|
| Other literature(s) |
N.D |
| PubDate |
1987 |
|