E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPSTPE0003(Stimulating peptide)
DFBP ID DFBPSTPE0003
Peptide sequence SSS
Type Native peptide
Peptide/Function name Stimulating peptide
Function-activity relationship
Main bioactivity Stimulating activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Ser-Ser-Ser
Single-letter amino acid SSS
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 279.24 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY -0.8000 c
Hydrophilic residue ratio 0% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine milk proteins
Precursor protein Caseins
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.2: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.3: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.4: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.5: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2
Source.6: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.7: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.8: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.9: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.10: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.11: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.12: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.13: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.14: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.15: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.16: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.17: DFBPPR0843 ---- Plant proteins ---- MADS-box transcription factor 1
Source.18: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.19: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.20: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.21: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.22: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.23: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.24: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.25: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.26: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A
Source.27: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.28: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.29: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.30: DFBPPR0876 ---- Plant proteins ---- Protein BZR1 homolog 1
Source.31: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.32: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.33: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.34: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.35: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2
Source.36: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.37: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.38: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.39: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.40: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.41: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.42: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.43: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.44: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.45: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.46: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.47: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.48: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.49: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.50: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.51: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.52: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.53: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.54: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.55: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.56: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.57: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.58: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.59: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.60: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.61: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.62: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.63: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.64: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.65: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.66: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.67: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.68: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.69: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.70: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.71: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.72: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.73: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.74: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.75: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.76: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.77: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.78: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.79: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.80: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.81: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.82: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.83: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.84: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.85: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.86: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50
Source.87: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.88: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.89: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.90: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.91: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.92: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.93: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.94: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.95: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.96: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.97: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.98: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.99: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.100: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.101: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.102: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.103: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.104: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.105: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE
Source.106: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.107: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.108: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.109: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.110: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3
Source.111: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.112: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.113: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.114: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.115: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.116: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.117: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.118: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.119: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.120: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.121: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.122: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.123: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A
Source.124: DFBPPR1154 ---- Plant proteins ---- MADS-box transcription factor 22
Source.125: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.126: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.127: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.128: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.129: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.130: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial
Source.131: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.132: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.133: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.134: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.135: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.136: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.137: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial
Source.138: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.139: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.140: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.141: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.142: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.143: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.144: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2
Source.145: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.146: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.147: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic
Source.148: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.149: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.150: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.151: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.152: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.153: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.154: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.155: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.156: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.157: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.158: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.159: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.160: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.161: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.162: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4
Source.163: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.164: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.165: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.166: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.167: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.168: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.169: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.170: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.171: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.172: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.173: DFBPPR1340 ---- Plant proteins ---- F-box protein GID2
Source.174: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.175: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.176: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.177: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.178: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.179: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.180: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.181: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.182: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.183: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.184: DFBPPR1363 ---- Plant proteins ---- Protein YELLOW LEAF 1, choloroplastic
Source.185: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.186: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.187: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.188: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.189: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.190: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.191: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.192: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.193: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.194: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.195: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.196: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.197: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.198: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.199: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.200: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.201: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.202: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.203: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.204: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.205: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.206: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.207: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.208: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.209: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.210: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.211: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.212: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.213: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.214: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.215: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic
Source.216: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.217: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.218: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.219: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.220: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.221: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.222: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.223: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.224: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.225: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.226: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.227: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1
Source.228: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.229: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.230: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic
Source.231: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.232: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.233: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.234: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.235: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.236: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.237: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.238: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.239: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.240: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.241: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.242: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.243: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.244: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.245: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.246: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.247: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.248: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.249: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.250: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.251: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.252: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.253: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.254: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.255: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.256: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.257: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.258: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.259: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.260: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.261: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.262: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.263: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.264: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51
Source.265: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.266: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.267: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.268: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.269: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.270: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.271: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.272: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.273: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.274: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.275: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.276: DFBPPR1597 ---- Plant proteins ---- MADS-box transcription factor 51
Source.277: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.278: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.279: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.280: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.281: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.282: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.283: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.284: DFBPPR1620 ---- Plant proteins ---- MADS-box transcription factor 29
Source.285: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.286: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.287: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.288: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.289: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.290: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.291: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.292: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.293: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.294: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.295: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.296: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.297: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.298: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.299: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.300: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.301: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.302: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.303: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.304: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.305: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1
Source.306: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.307: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.308: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.309: DFBPPR1696 ---- Plant proteins ---- Phytosulfokines 2
Source.310: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.311: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.312: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.313: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.314: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1
Source.315: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.316: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.317: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.318: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.319: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.320: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.321: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.322: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.323: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.324: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.325: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.326: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.327: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.328: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.329: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein
Source.330: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.331: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.332: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57
Source.333: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.334: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.335: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.336: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.337: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.338: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.339: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.340: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.341: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.342: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.343: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.344: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.345: DFBPPR1782 ---- Plant proteins ---- Transcription factor BHLH133
Source.346: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.347: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.348: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22
Source.349: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.350: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.351: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.352: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1
Source.353: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.354: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.355: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.356: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1
Source.357: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.358: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.359: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.360: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.361: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic
Source.362: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.363: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.364: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.365: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.366: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.367: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.368: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.369: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.370: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.371: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.372: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2
Source.373: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.374: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.375: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.376: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.377: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.378: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.379: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.380: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.381: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.382: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.383: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.384: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.385: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.386: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.387: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.388: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.389: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d
Source.390: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.391: DFBPPR1887 ---- Plant proteins ---- Probable glutathione S-transferase DHAR2, chloroplastic
Source.392: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.393: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.394: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.395: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.396: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.397: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.398: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.399: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.400: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.401: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.402: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.403: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.404: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.405: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.406: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.407: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.408: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.409: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.410: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.411: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.412: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.413: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.414: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.415: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.416: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.417: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.418: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.419: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.420: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.421: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.422: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.423: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.424: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30
Source.425: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.426: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.427: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4
Source.428: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38
Source.429: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.430: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.431: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.432: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.433: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.434: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.435: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1
Source.436: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.437: DFBPPR2015 ---- Plant proteins ---- 50S ribosomal protein L12, chloroplastic
Source.438: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.439: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5
Source.440: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.441: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.442: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.443: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.444: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.445: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.446: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.447: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.448: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.449: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.450: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.451: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.452: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.453: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.454: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.455: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.456: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2
Source.457: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.458: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.459: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.460: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.461: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.462: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.463: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.464: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.465: DFBPPR2101 ---- Plant proteins ---- Cupincin
Source.466: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.467: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.468: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.469: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1
Source.470: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.471: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.472: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.473: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.474: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.475: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.476: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.477: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.478: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.479: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic
Source.480: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.481: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein
Source.482: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.483: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.484: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.485: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.486: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.487: DFBPPR2148 ---- Plant proteins ---- Auxin-responsive protein SAUR36
Source.488: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.489: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2
Source.490: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.491: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.492: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.493: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.494: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.495: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.496: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.497: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.498: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.499: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.500: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.501: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.502: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.503: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.504: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.505: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.506: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.507: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.508: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.509: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.510: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.511: DFBPPR2223 ---- Plant proteins ---- Urease
Source.512: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.513: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.514: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.515: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.516: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.517: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.518: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.519: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.520: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.521: DFBPPR2261 ---- Plant proteins ---- Succinate dehydrogenase subunit 3-2, mitochondrial
Source.522: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.523: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.524: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.525: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.526: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3
Source.527: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.528: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.529: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.530: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.531: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.532: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.533: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.534: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.535: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.536: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.537: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.538: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.539: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.540: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.541: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.542: DFBPPR2305 ---- Plant proteins ---- Actin-depolymerizing factor 4
Source.543: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.544: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.545: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.546: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.547: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.548: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.549: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.550: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.551: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic
Source.552: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.553: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.554: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.555: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.556: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.557: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.558: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.559: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.560: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.561: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.562: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.563: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11
Source.564: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.565: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.566: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.567: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.568: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.569: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.570: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.571: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.572: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.573: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.574: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.575: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.576: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.577: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.578: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.579: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.580: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.581: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.582: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.583: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.584: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.585: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.586: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.587: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.588: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.589: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1
Source.590: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.591: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B
Source.592: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.593: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.594: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.595: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.596: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.597: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.598: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.599: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34
Source.600: DFBPPR2468 ---- Plant proteins ---- Germin-like protein 8-3
Source.601: DFBPPR2469 ---- Plant proteins ---- Germin-like protein 8-4
Source.602: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.603: DFBPPR2474 ---- Plant proteins ---- Two-component response regulator ORR10
Source.604: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.605: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.606: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.607: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.608: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.609: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.610: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4
Source.611: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b
Source.612: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.613: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.614: DFBPPR2516 ---- Plant proteins ---- Expansin-B16
Source.615: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.616: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.617: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.618: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.619: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.620: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.621: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.622: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.623: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.624: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.625: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.626: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.627: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.628: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.629: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.630: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20
Source.631: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.632: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.633: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9
Source.634: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.635: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.636: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.637: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic
Source.638: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.639: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.640: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.641: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.642: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.643: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.644: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.645: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.646: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.647: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.648: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.649: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.650: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.651: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.652: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.653: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial
Source.654: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.655: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34
Source.656: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.657: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.658: DFBPPR2638 ---- Plant proteins ---- Two-component response regulator ORR9
Source.659: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein
Source.660: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.661: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.662: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.663: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.664: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.665: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.666: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.667: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.668: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.669: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.670: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.671: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.672: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.673: DFBPPR2684 ---- Plant proteins ---- Arabinogalactan peptide 3
Source.674: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.675: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.676: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.677: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.678: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.679: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.680: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.681: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.682: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.683: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.684: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.685: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.686: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.687: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.688: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.689: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.690: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2
Source.691: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.692: DFBPPR2733 ---- Plant proteins ---- Metallothionein-like protein 1B
Source.693: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.694: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.695: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.696: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.697: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.698: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.699: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.700: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.701: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.702: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.703: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.704: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.705: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.706: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.707: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.708: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.709: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.710: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.711: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A
Source.712: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.713: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.714: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.715: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.716: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.717: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.718: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12
Source.719: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.720: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.721: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.722: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.723: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.724: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.725: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.726: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.727: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.728: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.729: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.730: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.731: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.732: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.733: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.734: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.735: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.736: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.737: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.738: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.739: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.740: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic
Source.741: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.742: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.743: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.744: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.745: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.746: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.747: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.748: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.749: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.750: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.751: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.752: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.753: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.754: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.755: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.756: DFBPPR2889 ---- Plant proteins ---- Monothiol glutaredoxin-S1, mitochondrial
Source.757: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.758: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21
Source.759: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.760: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.761: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.762: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.763: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.764: DFBPPR2908 ---- Plant proteins ---- Auxin-responsive protein IAA8
Source.765: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.766: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.767: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.768: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.769: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.770: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.771: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.772: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.773: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.774: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23
Source.775: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.776: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.777: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21
Source.778: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.779: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.780: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.781: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.782: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.783: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.784: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.785: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.786: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.787: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.788: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.789: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase
Source.790: DFBPPR3007 ---- Plant proteins ---- Thioredoxin H2-2
Source.791: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.792: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.793: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.794: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.795: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.796: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.797: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.798: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.799: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.800: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.801: DFBPPR3044 ---- Plant proteins ---- Thioredoxin-like 4, chloroplastic
Source.802: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.803: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.804: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1
Source.805: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.806: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.807: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.808: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.809: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic
Source.810: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.811: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.812: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.813: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.814: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.815: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.816: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.817: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.818: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.819: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.820: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.821: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.822: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.823: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.824: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.825: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.826: DFBPPR3108 ---- Plant proteins ---- Thioredoxin H4-2
Source.827: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1
Source.828: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.829: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.830: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.831: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.832: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.833: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.834: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6
Source.835: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.836: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.837: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.838: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.839: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13
Source.840: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8
Source.841: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.842: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.843: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.844: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.845: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.846: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.847: DFBPPR3177 ---- Plant proteins ---- Two-component response regulator ORR4
Source.848: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15
Source.849: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.850: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.851: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.852: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.853: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.854: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.855: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.856: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.857: DFBPPR3203 ---- Plant proteins ---- Monothiol glutaredoxin-S10
Source.858: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.859: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.860: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.861: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.862: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.863: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.864: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.865: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.866: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.867: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.868: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.869: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.870: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.871: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.872: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.873: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.874: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.875: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.876: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.877: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.878: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.879: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.880: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.881: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.882: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.883: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.884: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.885: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4
Source.886: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.887: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.888: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.889: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.890: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.891: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.892: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.893: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.894: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.895: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.896: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.897: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.898: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1
Source.899: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.900: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.901: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.902: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.903: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.904: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2
Source.905: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.906: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.907: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B
Source.908: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.909: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.910: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.911: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.912: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.913: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.914: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19
Source.915: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.916: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.917: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.918: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.919: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.920: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18
Source.921: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.922: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.923: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.924: DFBPPR3392 ---- Plant proteins ---- Auxin-responsive protein IAA9
Source.925: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7
Source.926: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.927: DFBPPR3397 ---- Plant proteins ---- Probable membrane-associated 30 kDa protein, chloroplastic
Source.928: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.929: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3
Source.930: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.931: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.932: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.933: DFBPPR3413 ---- Plant proteins ---- Probable histone H2AXa
Source.934: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic
Source.935: DFBPPR3418 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 3
Source.936: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.937: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.938: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.939: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.940: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.941: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3
Source.942: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1
Source.943: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.944: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.945: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.946: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.947: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.948: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.949: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.950: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.951: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44
Source.952: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.953: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.954: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.955: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.956: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.957: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.958: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.959: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.960: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.961: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.962: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.963: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.964: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8
Source.965: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.966: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.967: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.968: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32
Source.969: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1
Source.970: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.971: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.972: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.973: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.974: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.975: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.976: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.977: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.978: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.979: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.980: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.981: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10
Source.982: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.983: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4
Source.984: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.985: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7
Source.986: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.987: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.988: DFBPPR3547 ---- Plant proteins ---- Probable BRI1 kinase inhibitor 1
Source.989: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.990: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4
Source.991: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.992: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.993: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.994: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.995: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.996: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.997: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5
Source.998: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.999: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1000: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1001: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1002: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1003: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10
Source.1004: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.1005: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.1006: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1007: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.1008: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic
Source.1009: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.1010: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1011: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1012: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1013: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.1014: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.1015: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.1016: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1017: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.1018: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1
Source.1019: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.1020: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.1021: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2
Source.1022: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin
Source.1023: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1024: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.1025: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1026: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.1027: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1028: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.1029: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.1030: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.1031: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1032: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25
Source.1033: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.1034: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB
Source.1035: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1036: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.1037: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.1038: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.1039: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.1040: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.1041: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3
Source.1042: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.1043: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.1044: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.1045: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.1046: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.1047: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.1048: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.1049: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.1050: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.1051: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.1052: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.1053: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.1054: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1055: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.1056: DFBPPR3749 ---- Plant proteins ---- MADS-box transcription factor 25
Source.1057: DFBPPR3753 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.1058: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30
Source.1059: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.1060: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.1061: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1062: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.1063: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.1064: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.1065: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.1066: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.1067: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.1068: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.1069: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.1070: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1071: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1
Source.1072: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.1073: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.1074: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1075: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.1076: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.1077: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6
Source.1078: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.1079: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic
Source.1080: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1081: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.1082: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.1083: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.1084: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.1085: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.1086: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.1087: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7
Source.1088: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.1089: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.1090: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.1091: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.1092: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.1093: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.1094: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62
Source.1095: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.1096: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.1097: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.1098: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1099: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.1100: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10
Source.1101: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.1102: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.1103: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.1104: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.1105: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.1106: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.1107: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.1108: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.1109: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.1110: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.1111: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.1112: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5
Source.1113: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.1114: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.1115: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.1116: DFBPPR3908 ---- Plant proteins ---- Metallothionein-like protein 1A
Source.1117: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1118: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.1119: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1120: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.1121: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.1122: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.1123: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.1124: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.1125: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1
Source.1126: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.1127: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.1128: DFBPPR3960 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1129: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.1130: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.1131: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.1132: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.1133: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1134: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1135: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.1136: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.1137: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1138: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7
Source.1139: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1140: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1141: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.1142: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.1143: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1144: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.1145: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.1146: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.1147: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.1148: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.1149: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.1150: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.1151: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.1152: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11
Source.1153: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.1154: DFBPPR4017 ---- Plant proteins ---- Protein G1-like4
Source.1155: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1156: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.1157: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.1158: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.1159: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.1160: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1161: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27
Source.1162: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.1163: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.1164: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1165: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.1166: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.1167: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.1168: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.1169: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.1170: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.1171: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.1172: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1173: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.1174: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.1175: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.1176: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.1177: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.1178: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.1179: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.1180: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.1181: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D
Source.1182: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1183: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.1184: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.1185: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1186: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1187: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.1188: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.1189: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.1190: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.1191: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.1192: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.1193: DFBPPR4129 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 1
Source.1194: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.1195: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1196: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.1197: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1198: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.1199: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1200: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.1201: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1202: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.1203: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1204: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.1205: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1206: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6
Source.1207: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4
Source.1208: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog
Source.1209: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.1210: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1211: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.1212: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1213: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.1214: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.1215: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.1216: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2
Source.1217: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial
Source.1218: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1219: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1220: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.1221: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1222: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1223: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1
Source.1224: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1225: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1226: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1227: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1228: DFBPPR4223 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim13
Source.1229: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.1230: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1231: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.1232: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1233: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.1234: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.1235: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1236: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.1237: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.1238: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5
Source.1239: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1240: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1241: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63
Source.1242: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1243: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.1244: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.1245: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.1246: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.1247: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.1248: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.1249: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.1250: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1251: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.1252: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1253: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.1254: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.1255: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.1256: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.1257: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1258: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.1259: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.1260: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.1261: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.1262: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6
Source.1263: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.1264: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1265: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.1266: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.1267: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.1268: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.1269: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.1270: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.1271: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.1272: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.1273: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1274: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11
Source.1275: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.1276: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.1277: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic
Source.1278: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.1279: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1280: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1281: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.1282: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.1283: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.1284: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1285: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.1286: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.1287: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1288: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.1289: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.1290: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.1291: DFBPPR4407 ---- Plant proteins ---- Mini zinc finger protein 4
Source.1292: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.1293: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1294: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.1295: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.1296: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.1297: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1298: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.1299: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.1300: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.1301: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1302: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.1303: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.1304: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.1305: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.1306: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.1307: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.1308: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.1309: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.1310: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.1311: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1312: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.1313: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.1314: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.1315: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.1316: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.1317: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1318: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.1319: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.1320: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.1321: DFBPPR4483 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 11
Source.1322: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.1323: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.1324: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.1325: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1326: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.1327: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.1328: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.1329: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.1330: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B
Source.1331: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic
Source.1332: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.1333: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.1334: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.1335: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.1336: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.1337: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.1338: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.1339: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.1340: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.1341: DFBPPR4530 ---- Plant proteins ---- Water stress-inducible protein Rab21
Source.1342: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1343: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.1344: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.1345: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1346: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1347: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.1348: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.1349: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.1350: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.1351: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.1352: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.1353: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16
Source.1354: DFBPPR4562 ---- Plant proteins ---- Mini zinc finger protein 2
Source.1355: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1
Source.1356: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1
Source.1357: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.1358: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5
Source.1359: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.1360: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.1361: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.1362: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.1363: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.1364: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.1365: DFBPPR4593 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 15
Source.1366: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.1367: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.1368: DFBPPR4600 ---- Plant proteins ---- Probable U3 small nucleolar RNA-associated protein 11
Source.1369: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1370: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.1371: DFBPPR4606 ---- Plant proteins ---- ACT domain-containing protein DS12, chloroplastic
Source.1372: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16
Source.1373: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.1374: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.1375: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1376: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.1377: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.1378: DFBPPR4629 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 7
Source.1379: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.1380: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.1381: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.1382: DFBPPR4634 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 9
Source.1383: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.1384: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4
Source.1385: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.1386: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.1387: DFBPPR4646 ---- Plant proteins ---- 40S ribosomal protein S13-1
Source.1388: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.1389: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.1390: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2
Source.1391: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.1392: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.1393: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.1394: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.1395: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.1396: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.1397: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.1398: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.1399: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.1400: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.1401: DFBPPR4687 ---- Plant proteins ---- Dehydrin Rab16D
Source.1402: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.1403: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.1404: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3
Source.1405: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2
Source.1406: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1
Source.1407: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.1408: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6
Source.1409: DFBPPR4701 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 15
Source.1410: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.1411: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.1412: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.1413: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5
Source.1414: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.1415: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.1416: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.1417: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800
Source.1418: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.1419: DFBPPR4718 ---- Plant proteins ---- Protein TIFY 8
Source.1420: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.1421: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.1422: DFBPPR4726 ---- Plant proteins ---- 40S ribosomal protein S10-2
Source.1423: DFBPPR4728 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 12
Source.1424: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.1425: DFBPPR4730 ---- Plant proteins ---- 40S ribosomal protein S13-2
Source.1426: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.1427: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.1428: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.1429: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.1430: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400
Source.1431: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.1432: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.1433: DFBPPR4740 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 2
Source.1434: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.1435: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.1436: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.1437: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.1438: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1439: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1440: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.1441: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.1442: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.1443: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.1444: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.1445: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.1446: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.1447: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.1448: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.1449: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.1450: DFBPPR4780 ---- Plant proteins ---- Ripening-related protein 3
Source.1451: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.1452: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.1453: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600
Source.1454: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500
Source.1455: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300
Source.1456: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.1457: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.1458: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.1459: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.1460: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.1461: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.1462: DFBPPR4815 ---- Plant proteins ---- 40S ribosomal protein S10-1
Source.1463: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.1464: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.1465: DFBPPR4819 ---- Plant proteins ---- B3 domain-containing protein Os08g0324300
Source.1466: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.1467: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.1468: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1469: DFBPPR4836 ---- Plant proteins ---- Protein SPIRAL1-like 3
Source.1470: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5
Source.1471: DFBPPR4838 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 4
Source.1472: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3
Source.1473: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.1474: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800
Source.1475: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.1476: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.1477: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.1478: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.1479: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.1480: DFBPPR4864 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0625400
Source.1481: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.1482: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.1483: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820
Source.1484: DFBPPR4871 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0242900
Source.1485: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.1486: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.1487: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.1488: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58
Source.1489: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.1490: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.1491: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1492: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1493: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.1494: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1495: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.1496: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.1497: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1498: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5
Source.1499: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.1500: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic
Source.1501: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.1502: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.1503: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.1504: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.1505: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.1506: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.1507: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.1508: DFBPPR4943 ---- Plant proteins ---- Transcription repressor OFP8
Source.1509: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.1510: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1511: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.1512: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.1513: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.1514: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1515: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.1516: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.1517: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.1518: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.1519: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.1520: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.1521: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.1522: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.1523: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease
Source.1524: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1525: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.1526: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1527: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1528: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1529: DFBPPR5023 ---- Plant proteins ---- Protein SRC1
Source.1530: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.1531: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.1532: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.1533: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.1534: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1535: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A
Source.1536: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.1537: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.1538: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2
Source.1539: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1540: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.1541: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1542: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3
Source.1543: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.1544: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.1545: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.1546: DFBPPR5071 ---- Plant proteins ---- Leghemoglobin C1
Source.1547: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.1548: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.1549: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1550: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1551: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1552: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.1553: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1554: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1555: DFBPPR5159 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor D-II
Source.1556: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.1557: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1558: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.1559: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.1560: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.1561: DFBPPR5177 ---- Plant proteins ---- Anamorsin homolog
Source.1562: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic
Source.1563: DFBPPR5182 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 1
Source.1564: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.1565: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.1566: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1567: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.1568: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.1569: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2
Source.1570: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.1571: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.1572: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.1573: DFBPPR5281 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1574: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.1575: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1576: DFBPPR5311 ---- Plant proteins ---- Nodulin-20
Source.1577: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.1578: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.1579: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1
Source.1580: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.1581: DFBPPR5337 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial
Source.1582: DFBPPR5338 ---- Plant proteins ---- 40S ribosomal protein S13
Source.1583: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.1584: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11
Source.1585: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.1586: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C
Source.1587: DFBPPR5369 ---- Plant proteins ---- Early nodulin-36A
Source.1588: DFBPPR5372 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor C-II
Source.1589: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.1590: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1591: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.1592: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1593: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.1594: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1595: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.1596: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1597: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.1598: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1599: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1600: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1601: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.1602: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.1603: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.1604: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1605: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.1606: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.1607: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.1608: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.1609: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.1610: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1
Source.1611: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.1612: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1613: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1614: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.1615: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1616: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.1617: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic
Source.1618: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.1619: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.1620: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1621: DFBPPR5494 ---- Plant proteins ---- Peroxidase 70
Source.1622: DFBPPR5499 ---- Plant proteins ---- Dehydrin DHN1
Source.1623: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.1624: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1625: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.1626: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.1627: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42
Source.1628: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein
Source.1629: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.1630: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.1631: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.1632: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.1633: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.1634: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.1635: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1636: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1637: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1638: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.1639: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.1640: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1641: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.1642: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1643: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1644: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1645: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1646: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.1647: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1648: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.1649: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1650: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.1651: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1652: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.1653: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.1654: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A
Source.1655: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.1656: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6
Source.1657: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1658: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1659: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.1660: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.1661: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1662: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.1663: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.1664: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.1665: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.1666: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1667: DFBPPR5681 ---- Plant proteins ---- Single myb histone 4
Source.1668: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.1669: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1670: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.1671: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1672: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.1673: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1674: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.1675: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.1676: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.1677: DFBPPR5723 ---- Plant proteins ---- Single myb histone 3
Source.1678: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.1679: DFBPPR5736 ---- Plant proteins ---- Histone H1
Source.1680: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.1681: DFBPPR5755 ---- Plant proteins ---- Protein Iojap, chloroplastic
Source.1682: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.1683: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17
Source.1684: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1685: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.1686: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.1687: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1688: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.1689: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.1690: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1691: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.1692: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.1693: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.1694: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF
Source.1695: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.1696: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1697: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1698: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog
Source.1699: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.1700: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.1701: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2
Source.1702: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1703: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1704: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.1705: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.1706: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1707: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4
Source.1708: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1709: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1710: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.1711: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.1712: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5
Source.1713: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16
Source.1714: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1715: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.1716: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1
Source.1717: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.1718: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.1719: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1720: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B
Source.1721: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1722: DFBPPR5896 ---- Plant proteins ---- 50 kDa gamma-zein
Source.1723: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.1724: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B
Source.1725: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1726: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.1727: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A
Source.1728: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1729: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1730: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.1731: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.1732: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.1733: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2
Source.1734: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.1735: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.1736: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.1737: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38
Source.1738: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.1739: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.1740: DFBPPR6004 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1741: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1
Source.1742: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.1743: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1744: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.1745: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1746: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1747: DFBPPR6021 ---- Plant proteins ---- Actin-depolymerizing factor 2
Source.1748: DFBPPR6022 ---- Plant proteins ---- Stress-related protein 1
Source.1749: DFBPPR6026 ---- Plant proteins ---- Actin-depolymerizing factor 1
Source.1750: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.1751: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.1752: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1753: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.1754: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1755: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.1756: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.1757: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2
Source.1758: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1759: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1760: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.1761: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49
Source.1762: DFBPPR6133 ---- Plant proteins ---- 40S ribosomal protein S13
Source.1763: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.1764: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.1765: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.1766: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.1767: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5
Source.1768: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2
Source.1769: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4
Source.1770: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.1771: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3
Source.1772: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B
Source.1773: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.1774: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1775: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.1776: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1777: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.1778: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.1779: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1780: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.1781: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.1782: DFBPPR6231 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1783: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.1784: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1785: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1786: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.1787: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1788: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.1789: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.1790: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.1791: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.1792: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1793: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.1794: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1795: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1796: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1797: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.1798: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.1799: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1
Source.1800: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic
Source.1801: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.1802: DFBPPR6285 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1803: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.1804: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1805: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1806: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.1807: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.1808: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1809: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.1810: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.1811: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1812: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.1813: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1814: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.1815: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.1816: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.1817: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.1818: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.1819: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1820: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.1821: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.1822: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.1823: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic
Source.1824: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.1825: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1826: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.1827: DFBPPR6368 ---- Plant proteins ---- Provicilin
Source.1828: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.1829: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1830: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.1831: DFBPPR6377 ---- Plant proteins ---- Lectin
Source.1832: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.1833: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1834: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4
Source.1835: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.1836: DFBPPR6397 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1837: DFBPPR6401 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1838: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.1839: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1840: DFBPPR6410 ---- Plant proteins ---- Vicilin, 14 kDa component
Source.1841: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.1842: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.1843: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.1844: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1845: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.1846: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.1847: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1848: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.1849: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.1850: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.1851: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.1852: DFBPPR6464 ---- Plant proteins ---- 50S ribosomal protein 5, chloroplastic
Source.1853: DFBPPR6480 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic
Source.1854: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.1855: DFBPPR6483 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.1856: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.1857: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1858: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.1859: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5
Source.1860: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.1861: DFBPPR6499 ---- Plant proteins ---- Provicilin
Source.1862: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1863: DFBPPR6511 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1864: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1865: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.1866: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.1867: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.1868: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1869: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1870: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.1871: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.1872: DFBPPR6561 ---- Plant proteins ---- Blue copper protein
Source.1873: DFBPPR6573 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial
Source.1874: DFBPPR6585 ---- Plant proteins ---- 40S ribosomal protein S13
Source.1875: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.1876: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.1877: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1878: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1879: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1880: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.1881: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.1882: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.1883: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.1884: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.1885: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1886: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.1887: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.1888: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1889: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1890: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.1891: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1892: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.1893: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1894: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.1895: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.1896: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1897: DFBPPR6724 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.1898: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.1899: DFBPPR6754 ---- Plant proteins ---- Histone H2A.4
Source.1900: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1901: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7
Source.1902: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.1903: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.1904: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.1905: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.1906: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.1907: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1908: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.1909: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1910: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.1911: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C
Source.1912: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.1913: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.1914: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.1915: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.1916: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1917: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.1918: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1919: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1920: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410
Source.1921: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1922: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.1923: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.1924: DFBPPR6912 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1925: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1926: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.1927: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1928: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1929: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.1930: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.1931: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.1932: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.1933: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.1934: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1935: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1936: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1937: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1938: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.1939: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.1940: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.1941: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1942: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.1943: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.1944: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1945: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.1946: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.1947: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1948: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4
Source.1949: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1950: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1951: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.1952: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1953: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1954: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.1955: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1956: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.1957: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.1958: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1959: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.1960: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1961: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1962: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.1963: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.1964: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1965: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1966: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1967: DFBPPR7257 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1968: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic
Source.1969: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic
Source.1970: DFBPPR7287 ---- Plant proteins ---- Dehydrin DHN3
Source.1971: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4
Source.1972: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.1973: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1974: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1975: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1
Source.1976: DFBPPR7331 ---- Plant proteins ---- Dehydrin DHN2
Source.1977: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein
Source.1978: DFBPPR7353 ---- Plant proteins ---- Unknown endosperm protein E-15/E-16/E-17
Source.1979: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.1980: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.1981: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.1982: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.1983: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1984: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1985: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.1986: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1987: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1988: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.1989: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1990: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1991: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3
Source.1992: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4
Source.1993: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1994: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1995: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1996: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.1997: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1998: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1999: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.2000: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2001: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.2002: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.2003: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2004: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2005: DFBPPR7545 ---- Plant proteins ---- 60S ribosomal protein L15
Source.2006: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.2007: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.2008: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.2009: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.2010: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.2011: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.2012: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2013: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.2014: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.2015: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.2016: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.2017: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.2018: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.2019: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.2020: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.2021: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.2022: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2023: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.2024: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.2025: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein
Source.2026: DFBPPR7665 ---- Milk proteins ---- Beta-casein
Source.2027: DFBPPR7666 ---- Milk proteins ---- Whey acidic protein
Source.2028: DFBPPR7667 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.2029: DFBPPR7668 ---- Milk proteins ---- Beta-casein
Source.2030: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.2031: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A
Source.2032: DFBPPR7678 ---- Milk proteins ---- Whey acidic protein
Source.2033: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein
Source.2034: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein
Source.2035: DFBPPR7681 ---- Milk proteins ---- Beta-casein
Source.2036: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein
Source.2037: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein
Source.2038: DFBPPR7692 ---- Milk proteins ---- Beta-casein
Source.2039: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2040: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein
Source.2041: DFBPPR7700 ---- Milk proteins ---- Beta-casein
Source.2042: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein
Source.2043: DFBPPR7704 ---- Milk proteins ---- Whey acidic protein (tWAP)
Source.2044: DFBPPR7708 ---- Milk proteins ---- Late lactation protein B, LLP-B
Source.2045: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein
Source.2046: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.2047: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.2048: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.2049: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.2050: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.2051: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.2052: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2
Source.2053: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1
Source.2054: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.2055: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.2056: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2057: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.2058: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.2059: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.2060: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.2061: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.2062: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2063: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2064: DFBPPR8388 ---- Plant proteins ---- Oleosin Ara h 14.0101
Source.2065: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102
Source.2066: DFBPPR8395 ---- Plant proteins ---- Oleosin Ara h 14.0103
Source.2067: DFBPPR8398 ---- Plant proteins ---- Conglutin
Source.2068: DFBPPR8401 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor A-II
Source.2069: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.2070: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2071: DFBPPR8434 ---- Plant proteins ---- Lectin
Source.2072: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.2073: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.2074: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2075: DFBPPR8478 ---- Plant proteins ---- 50S ribosomal protein L12-1, chloroplastic
Source.2076: DFBPPR8479 ---- Plant proteins ---- 50S ribosomal protein L12-2, chloroplastic
Source.2077: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.2078: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.2079: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein
Source.2080: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.2081: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2082: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.2083: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.2084: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.2085: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor
Source.2086: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.2087: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.2088: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.2089: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.2090: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.2091: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.2092: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.2093: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2094: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.2095: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2096: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.2097: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2098: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.2099: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.2100: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.2101: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.2102: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.2103: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.2104: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.2105: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor
Source.2106: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.2107: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.2108: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2109: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.2110: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2111: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.2112: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.2113: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.2114: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.2115: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2116: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.2117: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.2118: DFBPPR16024 ---- Animal proteins ---- Podocalyxin
Source.2119: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.2120: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2121: DFBPPR16030 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2
Source.2122: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2123: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.2124: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.2125: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2126: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.2127: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2128: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.2129: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.2130: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.2131: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.2132: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.2133: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.2134: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2135: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2136: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.2137: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.2138: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.2139: DFBPPR16119 ---- Animal proteins ---- High mobility group protein HMG-I/HMG-Y
Source.2140: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.2141: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.2142: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2143: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.2144: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.2145: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.2146: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2147: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.2148: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.2149: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.2150: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.2151: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.2152: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.2153: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2154: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.2155: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.2156: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.2157: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.2158: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.2159: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.2160: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.2161: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2162: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.2163: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.2164: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.2165: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2166: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I
Source.2167: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.2168: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.2169: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.2170: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.2171: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.2172: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.2173: DFBPPR16244 ---- Animal proteins ---- Interleukin-2
Source.2174: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2175: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.2176: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.2177: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.2178: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.2179: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.2180: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.2181: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.2182: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2183: DFBPPR16287 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.2184: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2185: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2
Source.2186: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.2187: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.2188: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.2189: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.2190: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.2191: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.2192: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5
Source.2193: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.2194: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.2195: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.2196: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.2197: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.2198: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.2199: DFBPPR16474 ---- Animal proteins ---- Pinin
Source.2200: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.2201: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.2202: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.2203: DFBPPR16502 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.2204: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.2205: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.2206: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.2207: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.2208: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.2209: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator
Source.2210: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.2211: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.2212: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.2213: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.2214: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.2215: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.2216: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.2217: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.2218: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.2219: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.2220: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2221: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin
Source.2222: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.2223: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c
Source.2224: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.2225: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9
Source.2226: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.2227: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.2228: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.2229: DFBPPR16611 ---- Animal proteins ---- Nuclear transition protein 2
Source.2230: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.2231: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.2232: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2233: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.2234: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.2235: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.2236: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2
Source.2237: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.2238: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3
Source.2239: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.2240: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.2241: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.2242: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.2243: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.2244: DFBPPR16722 ---- Animal proteins ---- Ig heavy chain V region MOO
Source.2245: DFBPPR16730 ---- Animal proteins ---- RING finger protein 141
Source.2246: DFBPPR16732 ---- Animal proteins ---- HORMA domain-containing protein 2
Source.2247: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.2248: DFBPPR16744 ---- Animal proteins ---- Apoptotic protease-activating factor 1
Source.2249: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2250: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.2251: DFBPPR16784 ---- Animal proteins ---- Metallothionein-2
Source.2252: DFBPPR16793 ---- Animal proteins ---- Feather keratin Cos2-2
Source.2253: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.2254: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.2255: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.2256: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.2257: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.2258: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.2259: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.2260: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.2261: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.2262: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain
Source.2263: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.2264: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor
Source.2265: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial
Source.2266: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.2267: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2268: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I
Source.2269: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.2270: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.2271: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.2272: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.2273: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.2274: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial
Source.2275: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.2276: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.2277: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2278: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.2279: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.2280: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.2281: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.2282: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.2283: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.2284: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2285: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2286: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.2287: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.2288: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.2289: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.2290: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.2291: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.2292: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.2293: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.2294: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.2295: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.2296: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2297: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.2298: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.2299: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.2300: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.2301: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2302: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.2303: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.2304: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.2305: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.2306: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.2307: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta
Source.2308: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.2309: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.2310: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.2311: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.2312: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2313: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2314: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.2315: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1
Source.2316: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.2317: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.2318: DFBPPR17090 ---- Animal proteins ---- Phakinin
Source.2319: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.2320: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.2321: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.2322: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.2323: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.2324: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.2325: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.2326: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.2327: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short
Source.2328: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2329: DFBPPR17133 ---- Animal proteins ---- Pro-glucagon
Source.2330: DFBPPR17134 ---- Animal proteins ---- Pro-glucagon
Source.2331: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.2332: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.2333: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.2334: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.2335: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2336: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2337: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.2338: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.2339: DFBPPR17192 ---- Animal proteins ---- Kit ligand
Source.2340: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.2341: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.2342: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.2343: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.2344: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.2345: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.2346: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B
Source.2347: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.2348: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.2349: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.2350: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.2351: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.2352: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2353: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.2354: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.2355: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.2356: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.2357: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.2358: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.2359: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.2360: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.2361: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.2362: DFBPPR17319 ---- Animal proteins ---- Integrin beta-1-binding protein 1
Source.2363: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2364: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.2365: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.2366: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.2367: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1
Source.2368: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.2369: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.2370: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.2371: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.2372: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.2373: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6
Source.2374: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.2375: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.2376: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.2377: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.2378: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.2379: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.2380: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.2381: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.2382: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.2383: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.2384: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.2385: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.2386: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.2387: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.2388: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.2389: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.2390: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.2391: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.2392: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.2393: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.2394: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.2395: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.2396: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.2397: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2398: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.2399: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.2400: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.2401: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.2402: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.2403: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.2404: DFBPPR17484 ---- Animal proteins ---- Histone H1.8
Source.2405: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.2406: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.2407: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.2408: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.2409: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.2410: DFBPPR17521 ---- Animal proteins ---- Transforming growth factor beta-1-induced transcript 1 protein
Source.2411: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2412: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.2413: DFBPPR17529 ---- Animal proteins ---- C-type lectin domain family 7 member A
Source.2414: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.2415: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2416: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.2417: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.2418: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.2419: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.2420: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1
Source.2421: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.2422: DFBPPR17568 ---- Animal proteins ---- Interferon tau-2
Source.2423: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B
Source.2424: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.2425: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.2426: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.2427: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.2428: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.2429: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.2430: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.2431: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.2432: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.2433: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.2434: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2435: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.2436: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.2437: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.2438: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.2439: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2440: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta
Source.2441: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.2442: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.2443: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.2444: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.2445: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2446: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.2447: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0
Source.2448: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2449: DFBPPR17765 ---- Animal proteins ---- Ras-related protein Rab-27B
Source.2450: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.2451: DFBPPR17769 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.2452: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.2453: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.2454: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.2455: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.2456: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.2457: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.2458: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.2459: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.2460: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.2461: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.2462: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2463: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.2464: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.2465: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.2466: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.2467: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2468: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.2469: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.2470: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.2471: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.2472: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.2473: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.2474: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.2475: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor
Source.2476: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.2477: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.2478: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.2479: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.2480: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.2481: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.2482: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.2483: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.2484: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.2485: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.2486: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8
Source.2487: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.2488: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.2489: DFBPPR17916 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF126
Source.2490: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.2491: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.2492: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.2493: DFBPPR17928 ---- Animal proteins ---- CD40 ligand
Source.2494: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.2495: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2496: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.2497: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.2498: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.2499: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.2500: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.2501: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.2502: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.2503: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.2504: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.2505: DFBPPR17982 ---- Animal proteins ---- Sorting nexin-10
Source.2506: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.2507: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.2508: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.2509: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.2510: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.2511: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2512: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.2513: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.2514: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.2515: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.2516: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.2517: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.2518: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.2519: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.2520: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.2521: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.2522: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.2523: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2
Source.2524: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.2525: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.2526: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.2527: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.2528: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.2529: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.2530: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.2531: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2532: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta
Source.2533: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.2534: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.2535: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.2536: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.2537: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.2538: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.2539: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2540: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2541: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.2542: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.2543: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.2544: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.2545: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.2546: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.2547: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.2548: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.2549: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.2550: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.2551: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.2552: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.2553: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.2554: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.2555: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.2556: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2557: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.2558: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.2559: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.2560: DFBPPR18232 ---- Animal proteins ---- Ragulator complex protein LAMTOR1
Source.2561: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.2562: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.2563: DFBPPR18247 ---- Animal proteins ---- Interferon regulatory factor 1
Source.2564: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6
Source.2565: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.2566: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.2567: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.2568: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.2569: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta
Source.2570: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.2571: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2572: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A
Source.2573: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.2574: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.2575: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.2576: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.2577: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.2578: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.2579: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.2580: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2
Source.2581: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.2582: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.2583: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.2584: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.2585: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.2586: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.2587: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.2588: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.2589: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.2590: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1
Source.2591: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.2592: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.2593: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3
Source.2594: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.2595: DFBPPR18394 ---- Animal proteins ---- Histone H1.1
Source.2596: DFBPPR18396 ---- Animal proteins ---- Corticoliberin
Source.2597: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.2598: DFBPPR18407 ---- Animal proteins ---- DNA damage-inducible transcript 4 protein
Source.2599: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.2600: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.2601: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2602: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.2603: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.2604: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.2605: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.2606: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.2607: DFBPPR18433 ---- Animal proteins ---- Basigin
Source.2608: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.2609: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.2610: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2
Source.2611: DFBPPR18449 ---- Animal proteins ---- Prepronociceptin
Source.2612: DFBPPR18451 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.2613: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.2614: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.2615: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.2616: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.2617: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.2618: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.2619: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.2620: DFBPPR18480 ---- Animal proteins ---- Casein kinase I isoform gamma-3
Source.2621: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.2622: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.2623: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.2624: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.2625: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5
Source.2626: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.2627: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.2628: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.2629: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.2630: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.2631: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.2632: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.2633: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.2634: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.2635: DFBPPR18552 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 8
Source.2636: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3
Source.2637: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal
Source.2638: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1
Source.2639: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.2640: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.2641: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.2642: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.2643: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor
Source.2644: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.2645: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.2646: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4
Source.2647: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.2648: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.2649: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.2650: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha
Source.2651: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.2652: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.2653: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.2654: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.2655: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.2656: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.2657: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.2658: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.2659: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2
Source.2660: DFBPPR18727 ---- Animal proteins ---- Interleukin-2
Source.2661: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.2662: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.2663: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.2664: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.2665: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II
Source.2666: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.2667: DFBPPR18746 ---- Animal proteins ---- Anamorsin
Source.2668: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.2669: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.2670: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.2671: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.2672: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.2673: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A
Source.2674: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.2675: DFBPPR18785 ---- Animal proteins ---- Protein lin-7 homolog C
Source.2676: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.2677: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.2678: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.2679: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.2680: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.2681: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.2682: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.2683: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2684: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.2685: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.2686: DFBPPR18841 ---- Animal proteins ---- PHD finger protein 6
Source.2687: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.2688: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.2689: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3
Source.2690: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.2691: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.2692: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.2693: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.2694: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.2695: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase
Source.2696: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.2697: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.2698: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.2699: DFBPPR18889 ---- Animal proteins ---- Achaete-scute homolog 2
Source.2700: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2
Source.2701: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.2702: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.2703: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.2704: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.2705: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.2706: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.2707: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10
Source.2708: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.2709: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.2710: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.2711: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.2712: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.2713: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.2714: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.2715: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.2716: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.2717: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.2718: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.2719: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.2720: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.2721: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.2722: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.2723: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.2724: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.2725: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.2726: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.2727: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.2728: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.2729: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.2730: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.2731: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.2732: DFBPPR19023 ---- Animal proteins ---- Cellular nucleic acid-binding protein
Source.2733: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.2734: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.2735: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.2736: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2737: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.2738: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.2739: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.2740: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.2741: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.2742: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.2743: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.2744: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.2745: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.2746: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.2747: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1
Source.2748: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.2749: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.2750: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.2751: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.2752: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.2753: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.2754: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.2755: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.2756: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.2757: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.2758: DFBPPR19146 ---- Animal proteins ---- Protein S100-A7
Source.2759: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.2760: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.2761: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.2762: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.2763: DFBPPR19164 ---- Animal proteins ---- RNA-binding protein with serine-rich domain 1
Source.2764: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.2765: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.2766: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2767: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.2768: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A
Source.2769: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639
Source.2770: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169
Source.2771: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.2772: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.2773: DFBPPR19222 ---- Animal proteins ---- Interferon alpha-H
Source.2774: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.2775: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.2776: DFBPPR19229 ---- Animal proteins ---- Interferon alpha-F
Source.2777: DFBPPR19230 ---- Animal proteins ---- Interferon alpha-G
Source.2778: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.2779: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.2780: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.2781: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit
Source.2782: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.2783: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.2784: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.2785: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like
Source.2786: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2787: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2
Source.2788: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.2789: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.2790: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.2791: DFBPPR19275 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-5
Source.2792: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.2793: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.2794: DFBPPR19288 ---- Animal proteins ---- Interferon alpha-C
Source.2795: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.2796: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.2797: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B
Source.2798: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220
Source.2799: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.2800: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.2801: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.2802: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.2803: DFBPPR19322 ---- Animal proteins ---- Interferon alpha-A
Source.2804: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.2805: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.2806: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.2807: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.2808: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9
Source.2809: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.2810: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.2811: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.2812: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.2813: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.2814: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.2815: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.2816: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.2817: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.2818: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1
Source.2819: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.2820: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.2821: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3
Source.2822: DFBPPR19400 ---- Animal proteins ---- Serine/arginine-rich splicing factor 6
Source.2823: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog
Source.2824: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.2825: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22
Source.2826: DFBPPR19434 ---- Animal proteins ---- Interferon alpha-B
Source.2827: DFBPPR19435 ---- Animal proteins ---- Interferon alpha-D
Source.2828: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.2829: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2830: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.2831: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B
Source.2832: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.2833: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.2834: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.2835: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.2836: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.2837: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5
Source.2838: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.2839: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.2840: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.2841: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.2842: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.2843: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.2844: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.2845: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.2846: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.2847: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.2848: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.2849: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1
Source.2850: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.2851: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.2852: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.2853: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2854: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4
Source.2855: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.2856: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.2857: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.2858: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.2859: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.2860: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.2861: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.2862: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.2863: DFBPPR19585 ---- Animal proteins ---- Interferon alpha-1
Source.2864: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.2865: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.2866: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.2867: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2868: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2869: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.2870: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2871: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.2872: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.2873: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.2874: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.2875: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.2876: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.2877: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.2878: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.2879: DFBPPR19662 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1
Source.2880: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.2881: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.2882: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.2883: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5
Source.2884: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.2885: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.2886: DFBPPR19696 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.2887: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.2888: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.2889: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1
Source.2890: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3
Source.2891: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.2892: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.2893: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.2894: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.2895: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5
Source.2896: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.2897: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.2898: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.2899: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.2900: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4
Source.2901: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.2902: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit
Source.2903: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.2904: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.2905: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1
Source.2906: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.2907: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.2908: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2
Source.2909: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.2910: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.2911: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.2912: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.2913: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.2914: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.2915: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.2916: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.2917: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.2918: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1
Source.2919: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.2920: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.2921: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.2922: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.2923: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.2924: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.2925: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.2926: DFBPPR19886 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4A
Source.2927: DFBPPR19892 ---- Animal proteins ---- D(1B) dopamine receptor
Source.2928: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.2929: DFBPPR19909 ---- Animal proteins ---- Probable C->U-editing enzyme APOBEC-2
Source.2930: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.2931: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.2932: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.2933: DFBPPR19929 ---- Animal proteins ---- Ermin
Source.2934: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.2935: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.2936: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.2937: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.2938: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.2939: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.2940: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.2941: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.2942: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.2943: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2944: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.2945: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.2946: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.2947: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16
Source.2948: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer
Source.2949: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.2950: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1
Source.2951: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.2952: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.2953: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.2954: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.2955: DFBPPR20034 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C1, mitochondrial
Source.2956: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.2957: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.2958: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.2959: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.2960: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.2961: DFBPPR20063 ---- Animal proteins ---- Histone H2B subacrosomal variant
Source.2962: DFBPPR20065 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3
Source.2963: DFBPPR20067 ---- Animal proteins ---- Glutaredoxin-2, mitochondrial
Source.2964: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.2965: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.2966: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.2967: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2
Source.2968: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.2969: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1
Source.2970: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.2971: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.2972: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4
Source.2973: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.2974: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23
Source.2975: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.2976: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.2977: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.2978: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2979: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.2980: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.2981: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.2982: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.2983: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.2984: DFBPPR20175 ---- Animal proteins ---- Selenoprotein K
Source.2985: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.2986: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.2987: DFBPPR20188 ---- Animal proteins ---- Protein S100-A16
Source.2988: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.2989: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.2990: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.2991: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4
Source.2992: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1
Source.2993: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.2994: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.2995: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.2996: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.2997: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.2998: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2999: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.3000: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.3001: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.3002: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54
Source.3003: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1
Source.3004: DFBPPR20268 ---- Animal proteins ---- Nuclear transition protein 2
Source.3005: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.3006: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.3007: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.3008: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1
Source.3009: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.3010: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.3011: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.3012: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.3013: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.3014: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.3015: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.3016: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1
Source.3017: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.3018: DFBPPR20340 ---- Animal proteins ---- Peripherin
Source.3019: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.3020: DFBPPR20350 ---- Animal proteins ---- Pinin
Source.3021: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.3022: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.3023: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7
Source.3024: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.3025: DFBPPR20365 ---- Animal proteins ---- Interleukin-21
Source.3026: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.3027: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2
Source.3028: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.3029: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.3030: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.3031: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.3032: DFBPPR20391 ---- Animal proteins ---- Fibronectin type III domain-containing protein 4
Source.3033: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.3034: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.3035: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.3036: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.3037: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.3038: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2
Source.3039: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.3040: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.3041: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7
Source.3042: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.3043: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.3044: DFBPPR20461 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm8
Source.3045: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.3046: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.3047: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.3048: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator
Source.3049: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.3050: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan
Source.3051: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.3052: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.3053: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog
Source.3054: DFBPPR20497 ---- Animal proteins ---- Serine/Arginine-related protein 53
Source.3055: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4
Source.3056: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.3057: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.3058: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.3059: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.3060: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2
Source.3061: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.3062: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.3063: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.3064: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.3065: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.3066: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.3067: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16
Source.3068: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.3069: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.3070: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.3071: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.3072: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.3073: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1
Source.3074: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.3075: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.3076: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.3077: DFBPPR20600 ---- Animal proteins ---- Regulator of G-protein signaling 10
Source.3078: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.3079: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.3080: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.3081: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.3082: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.3083: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.3084: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.3085: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.3086: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.3087: DFBPPR20635 ---- Animal proteins ---- Transcription elongation factor A protein 1
Source.3088: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.3089: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.3090: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.3091: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.3092: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.3093: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.3094: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.3095: DFBPPR20682 ---- Animal proteins ---- 26S proteasome regulatory subunit 10B
Source.3096: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.3097: DFBPPR20704 ---- Animal proteins ---- C-X-C motif chemokine 17
Source.3098: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.3099: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.3100: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.3101: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.3102: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.3103: DFBPPR20725 ---- Animal proteins ---- RBPJ-interacting and tubulin-associated protein 1
Source.3104: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.3105: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12
Source.3106: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.3107: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.3108: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.3109: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf
Source.3110: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.3111: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.3112: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.3113: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.3114: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.3115: DFBPPR20805 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.3116: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.3117: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1
Source.3118: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.3119: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6
Source.3120: DFBPPR20831 ---- Animal proteins ---- Keratin, type II cytoskeletal 59 kDa, component IV
Source.3121: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.3122: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.3123: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.3124: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.3125: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.3126: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.3127: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.3128: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase
Source.3129: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.3130: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.3131: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.3132: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.3133: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.3134: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.3135: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3
Source.3136: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.3137: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.3138: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.3139: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.3140: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.3141: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.3142: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.3143: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3144: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.3145: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.3146: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein
Source.3147: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.3148: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.3149: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.3150: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.3151: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.3152: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.3153: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.3154: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.3155: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.3156: DFBPPR21013 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit D
Source.3157: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.3158: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.3159: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.3160: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.3161: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.3162: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.3163: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.3164: DFBPPR21063 ---- Animal proteins ---- Zinc finger protein 691
Source.3165: DFBPPR21070 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IA
Source.3166: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.3167: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.3168: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.3169: DFBPPR21087 ---- Animal proteins ---- Claudin-11
Source.3170: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.3171: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.3172: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.3173: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.3174: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.3175: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.3176: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.3177: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin
Source.3178: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.3179: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III
Source.3180: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7
Source.3181: DFBPPR21145 ---- Animal proteins ---- Transcription elongation factor SPT4
Source.3182: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.3183: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.3184: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.3185: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.3186: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.3187: DFBPPR21185 ---- Animal proteins ---- Lymphocyte antigen 6H
Source.3188: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.3189: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.3190: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.3191: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.3192: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2
Source.3193: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.3194: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.3195: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.3196: DFBPPR21267 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.3197: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.3198: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21
Source.3199: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.3200: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.3201: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.3202: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.3203: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D
Source.3204: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.3205: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.3206: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.3207: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.3208: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner
Source.3209: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.3210: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.3211: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.3212: DFBPPR21323 ---- Animal proteins ---- Trefoil factor 3
Source.3213: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.3214: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.3215: DFBPPR21336 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.3216: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.3217: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.3218: DFBPPR21353 ---- Animal proteins ---- Zinc finger protein OZF
Source.3219: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.3220: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.3221: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.3222: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.3223: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.3224: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.3225: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.3226: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.3227: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.3228: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.3229: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.3230: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37
Source.3231: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.3232: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.3233: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1
Source.3234: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.3235: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.3236: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.3237: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.3238: DFBPPR21425 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 A
Source.3239: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.3240: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.3241: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2
Source.3242: DFBPPR21450 ---- Animal proteins ---- Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1
Source.3243: DFBPPR21465 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD
Source.3244: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.3245: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.3246: DFBPPR21477 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 35
Source.3247: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.3248: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.3249: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.3250: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1
Source.3251: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3
Source.3252: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.3253: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.3254: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.3255: DFBPPR21509 ---- Animal proteins ---- Myoneurin
Source.3256: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.3257: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.3258: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.3259: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.3260: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.3261: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.3262: DFBPPR21544 ---- Animal proteins ---- General transcription factor IIE subunit 2
Source.3263: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.3264: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c
Source.3265: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.3266: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.3267: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.3268: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19
Source.3269: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3270: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.3271: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.3272: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.3273: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.3274: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19
Source.3275: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial
Source.3276: DFBPPR21639 ---- Animal proteins ---- Elongator complex protein 4
Source.3277: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.3278: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.3279: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.3280: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.3281: DFBPPR21674 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3B
Source.3282: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.3283: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.3284: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.3285: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.3286: DFBPPR21709 ---- Animal proteins ---- PEST proteolytic signal-containing nuclear protein
Source.3287: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.3288: DFBPPR21717 ---- Animal proteins ---- Transmembrane protein 134
Source.3289: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.3290: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.3291: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.3292: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.3293: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.3294: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.3295: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.3296: DFBPPR21749 ---- Animal proteins ---- Protein CUSTOS
Source.3297: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.3298: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.3299: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12
Source.3300: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.3301: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.3302: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.3303: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.3304: DFBPPR21794 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 8
Source.3305: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.3306: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.3307: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.3308: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1
Source.3309: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.3310: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.3311: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.3312: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.3313: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.3314: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.3315: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.3316: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein
Source.3317: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2
Source.3318: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.3319: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1
Source.3320: DFBPPR21851 ---- Animal proteins ---- TSC22 domain family protein 1
Source.3321: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.3322: DFBPPR21855 ---- Animal proteins ---- Proline-rich nuclear receptor coactivator 2
Source.3323: DFBPPR21858 ---- Animal proteins ---- Chromatin complexes subunit BAP18
Source.3324: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS
Source.3325: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.3326: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.3327: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.3328: DFBPPR21880 ---- Animal proteins ---- Zinc finger protein 22
Source.3329: DFBPPR21882 ---- Animal proteins ---- Insulin-like peptide INSL6
Source.3330: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.3331: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1
Source.3332: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.3333: DFBPPR21892 ---- Animal proteins ---- COMM domain-containing protein 9
Source.3334: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.3335: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1
Source.3336: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.3337: DFBPPR21905 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 2
Source.3338: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.3339: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2
Source.3340: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12
Source.3341: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.3342: DFBPPR21927 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase-interacting protein
Source.3343: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3344: DFBPPR21930 ---- Animal proteins ---- Protein Churchill
Source.3345: DFBPPR21932 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IB
Source.3346: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.3347: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.3348: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.3349: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.3350: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.3351: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.3352: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.3353: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.3354: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.3355: DFBPPR21957 ---- Animal proteins ---- LIM domain transcription factor LMO4
Source.3356: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.3357: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.3358: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.3359: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.3360: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.3361: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.3362: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.3363: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.3364: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.3365: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.3366: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.3367: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.3368: DFBPPR22035 ---- Animal proteins ---- Protein CCSMST1
Source.3369: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ
Source.3370: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1
Source.3371: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.3372: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.3373: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B
Source.3374: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4
Source.3375: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein
Source.3376: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.3377: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.3378: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.3379: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.3380: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.3381: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.3382: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.3383: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.3384: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.3385: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.3386: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B
Source.3387: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.3388: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.3389: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.3390: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.3391: DFBPPR22193 ---- Animal proteins ---- CapZ-interacting protein
Source.3392: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.3393: DFBPPR22199 ---- Animal proteins ---- SCAN domain-containing protein 1
Source.3394: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.3395: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.3396: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.3397: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.3398: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.3399: DFBPPR22242 ---- Animal proteins ---- Neuropeptide S
Source.3400: DFBPPR22243 ---- Animal proteins ---- COMM domain-containing protein 4
Source.3401: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.3402: DFBPPR22253 ---- Animal proteins ---- Inhibitory synaptic factor 1
Source.3403: DFBPPR22268 ---- Animal proteins ---- Keratin-associated protein 10-8
Source.3404: DFBPPR22269 ---- Animal proteins ---- Protein preY, mitochondrial
Source.3405: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.3406: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.3407: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.3408: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.3409: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.3410: DFBPPR22295 ---- Animal proteins ---- Protein PROCA1
Source.3411: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein
Source.3412: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.3413: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1
Source.3414: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.3415: DFBPPR22324 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.3416: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.3417: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.3418: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.3419: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.3420: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.3421: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.3422: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.3423: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11
Source.3424: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.3425: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like
Source.3426: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.3427: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.3428: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1
Source.3429: DFBPPR22392 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1A
Source.3430: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein
Source.3431: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog
Source.3432: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.3433: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.3434: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.3435: DFBPPR22411 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 2
Source.3436: DFBPPR22413 ---- Animal proteins ---- Protein LSM12 homolog
Source.3437: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.3438: DFBPPR22430 ---- Animal proteins ---- UPF0561 protein C2orf68 homolog
Source.3439: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.3440: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.3441: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.3442: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97
Source.3443: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149
Source.3444: DFBPPR22461 ---- Animal proteins ---- Ashwin
Source.3445: DFBPPR22462 ---- Animal proteins ---- Protein FAM76A
Source.3446: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.3447: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.3448: DFBPPR22480 ---- Animal proteins ---- Coiled-coil domain-containing protein 70
Source.3449: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.3450: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.3451: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1
Source.3452: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.3453: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.3454: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.3455: DFBPPR22533 ---- Animal proteins ---- Coiled-coil domain-containing protein 160
Source.3456: DFBPPR22535 ---- Animal proteins ---- Protein FAM205C
Source.3457: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.3458: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25
Source.3459: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1
Source.3460: DFBPPR22544 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 2
Source.3461: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.3462: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.3463: DFBPPR22581 ---- Animal proteins ---- UPF0690 protein C1orf52 homolog
Source.3464: DFBPPR22582 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein
Source.3465: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog
Source.3466: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171
Source.3467: DFBPPR22593 ---- Animal proteins ---- UPF0688 protein C1orf174 homolog
Source.3468: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.3469: DFBPPR22612 ---- Animal proteins ---- Glutamate-rich protein 5
Source.3470: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B
Source.3471: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.3472: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61
Source.3473: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.3474: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.3475: DFBPPR22656 ---- Animal proteins ---- Putative coiled-coil domain-containing protein 196
Source.3476: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D
Source.3477: DFBPPR22660 ---- Animal proteins ---- Leydig cell tumor 10 kDa protein homolog
Source.3478: DFBPPR22666 ---- Animal proteins ---- Uncharacterized protein C12orf50 homolog
Source.3479: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog
Source.3480: DFBPPR22671 ---- Animal proteins ---- Uncharacterized protein C1orf185 homolog
Source.3481: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9
Source.3482: DFBPPR22675 ---- Animal proteins ---- UPF0711 protein C18orf21 homolog
Source.3483: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.3484: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.3485: DFBPPR22682 ---- Animal proteins ---- Protein FAM216A
Source.3486: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A
Source.3487: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.3488: DFBPPR22692 ---- Animal proteins ---- Protein FAM229B
Source.3489: DFBPPR22702 ---- Animal proteins ---- Coiled-coil domain-containing protein 83
Source.3490: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.3491: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2
Source.3492: DFBPPR22719 ---- Animal proteins ---- Uncharacterized protein C12orf45 homolog
Source.3493: DFBPPR22722 ---- Animal proteins ---- Uncharacterized protein C11orf91 homolog
Source.3494: DFBPPR22725 ---- Animal proteins ---- Uncharacterized protein C4orf46 homolog
Source.3495: DFBPPR22726 ---- Animal proteins ---- Uncharacterized protein C16orf90 homolog
Source.3496: DFBPPR22734 ---- Animal proteins ---- Uncharacterized protein C1orf226 homolog
Source.3497: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog
Source.3498: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.3499: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.3500: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog
Source.3501: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.3502: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog
Source.3503: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog
Source.3504: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog
Source.3505: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog
Source.3506: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.3507: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3508: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.3509: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.3510: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.3511: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.3512: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.3513: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.3514: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.3515: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.3516: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.3517: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.3518: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.3519: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.3520: DFBPPR8628 ---- Animal proteins ---- Inhibin beta A chain
Source.3521: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.3522: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.3523: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.3524: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.3525: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A
Source.3526: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.3527: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.3528: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.3529: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.3530: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.3531: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3532: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.3533: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.3534: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.3535: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.3536: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.3537: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor
Source.3538: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.3539: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.3540: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3541: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.3542: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.3543: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.3544: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3545: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.3546: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.3547: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.3548: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.3549: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.3550: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.3551: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.3552: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.3553: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.3554: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.3555: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.3556: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.3557: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3558: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3559: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.3560: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.3561: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3562: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.3563: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3564: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.3565: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.3566: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.3567: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.3568: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.3569: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.3570: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.3571: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3572: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.3573: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3574: DFBPPR8831 ---- Animal proteins ---- Interferon regulatory factor 1
Source.3575: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.3576: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.3577: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.3578: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.3579: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.3580: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.3581: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.3582: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3583: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.3584: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3585: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.3586: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.3587: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.3588: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.3589: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.3590: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.3591: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.3592: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta
Source.3593: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.3594: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.3595: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3596: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.3597: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.3598: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.3599: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3600: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3601: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.3602: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.3603: DFBPPR9033 ---- Animal proteins ---- Interleukin-2
Source.3604: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.3605: DFBPPR9037 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain
Source.3606: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.3607: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.3608: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.3609: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.3610: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.3611: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.3612: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.3613: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.3614: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3615: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I
Source.3616: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3617: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3618: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3619: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.3620: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.3621: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II
Source.3622: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.3623: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.3624: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.3625: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.3626: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.3627: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.3628: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.3629: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.3630: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.3631: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.3632: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3633: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.3634: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.3635: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.3636: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.3637: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1
Source.3638: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.3639: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.3640: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.3641: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.3642: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.3643: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.3644: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.3645: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.3646: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.3647: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.3648: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3649: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.3650: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.3651: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.3652: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.3653: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.3654: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.3655: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.3656: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.3657: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.3658: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.3659: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.3660: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.3661: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.3662: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.3663: DFBPPR9374 ---- Animal proteins ---- Casein kinase II subunit beta
Source.3664: DFBPPR9385 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.3665: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.3666: DFBPPR9408 ---- Animal proteins ---- CD70 antigen
Source.3667: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.3668: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.3669: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.3670: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.3671: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.3672: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.3673: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3674: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3675: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.3676: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3677: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.3678: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.3679: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.3680: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.3681: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.3682: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.3683: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.3684: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.3685: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.3686: DFBPPR9572 ---- Animal proteins ---- Nuclear transition protein 2
Source.3687: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.3688: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.3689: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.3690: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.3691: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.3692: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.3693: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.3694: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.3695: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.3696: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.3697: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.3698: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3699: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1
Source.3700: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.3701: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.3702: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3703: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.3704: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3705: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.3706: DFBPPR9695 ---- Animal proteins ---- Seminal plasma sperm motility inhibitor
Source.3707: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.3708: DFBPPR9702 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.3709: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.3710: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.3711: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.3712: DFBPPR9733 ---- Animal proteins ---- Interleukin-17A
Source.3713: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2
Source.3714: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.3715: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region
Source.3716: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3717: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.3718: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.3719: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.3720: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.3721: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.3722: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.3723: DFBPPR9851 ---- Animal proteins ---- Fibromodulin
Source.3724: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.3725: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.3726: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2
Source.3727: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3
Source.3728: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.3729: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin
Source.3730: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.3731: DFBPPR9936 ---- Animal proteins ---- Serum amyloid A-4 protein
Source.3732: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.3733: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.3734: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.3735: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3736: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.3737: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.3738: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I
Source.3739: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.3740: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.3741: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein
Source.3742: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.3743: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.3744: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.3745: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.3746: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.3747: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.3748: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.3749: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.3750: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.3751: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.3752: DFBPPR10054 ---- Animal proteins ---- Kit ligand
Source.3753: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.3754: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.3755: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3756: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.3757: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3758: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3759: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3760: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.3761: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.3762: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.3763: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.3764: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.3765: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.3766: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.3767: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3768: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.3769: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.3770: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.3771: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.3772: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.3773: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.3774: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.3775: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.3776: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.3777: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.3778: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.3779: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.3780: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.3781: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.3782: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.3783: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.3784: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.3785: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3786: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.3787: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.3788: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.3789: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.3790: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.3791: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.3792: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.3793: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.3794: DFBPPR10187 ---- Animal proteins ---- Myogenin
Source.3795: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.3796: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.3797: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.3798: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.3799: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.3800: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.3801: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.3802: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.3803: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.3804: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.3805: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.3806: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.3807: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.3808: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.3809: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.3810: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.3811: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.3812: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.3813: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.3814: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.3815: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1
Source.3816: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain
Source.3817: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.3818: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.3819: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.3820: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3821: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.3822: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.3823: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.3824: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.3825: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.3826: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.3827: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.3828: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.3829: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.3830: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3831: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.3832: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.3833: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.3834: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.3835: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.3836: DFBPPR10298 ---- Animal proteins ---- Caldesmon
Source.3837: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.3838: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.3839: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.3840: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3841: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.3842: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3843: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.3844: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.3845: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.3846: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.3847: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.3848: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.3849: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.3850: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.3851: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3852: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.3853: DFBPPR10341 ---- Animal proteins ---- Brain acid soluble protein 1 homolog
Source.3854: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.3855: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.3856: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.3857: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.3858: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.3859: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.3860: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.3861: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.3862: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.3863: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3864: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.3865: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.3866: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.3867: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.3868: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.3869: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.3870: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.3871: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.3872: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.3873: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.3874: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.3875: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.3876: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.3877: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3878: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.3879: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.3880: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.3881: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.3882: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.3883: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.3884: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.3885: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.3886: DFBPPR10428 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.3887: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3888: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3889: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3890: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.3891: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.3892: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3893: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.3894: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.3895: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.3896: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.3897: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.3898: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.3899: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.3900: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.3901: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.3902: DFBPPR10477 ---- Animal proteins ---- Aprataxin
Source.3903: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.3904: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6
Source.3905: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.3906: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1
Source.3907: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.3908: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.3909: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.3910: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3911: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.3912: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.3913: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3
Source.3914: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.3915: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.3916: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.3917: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.3918: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.3919: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.3920: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.3921: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog
Source.3922: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.3923: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.3924: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3925: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.3926: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.3927: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.3928: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.3929: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.3930: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3931: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3932: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6
Source.3933: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.3934: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.3935: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.3936: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.3937: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.3938: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.3939: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.3940: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.3941: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.3942: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.3943: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.3944: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.3945: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.3946: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.3947: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.3948: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.3949: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.3950: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.3951: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.3952: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.3953: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.3954: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.3955: DFBPPR10660 ---- Animal proteins ---- Tsukushin
Source.3956: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3957: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.3958: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.3959: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.3960: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.3961: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.3962: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.3963: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3964: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.3965: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.3966: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.3967: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.3968: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.3969: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.3970: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3971: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.3972: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.3973: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.3974: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.3975: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.3976: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.3977: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3978: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3979: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3980: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.3981: DFBPPR10785 ---- Animal proteins ---- Cytochrome b5
Source.3982: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.3983: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.3984: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3985: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.3986: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.3987: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.3988: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.3989: DFBPPR10831 ---- Animal proteins ---- Early growth response protein 1
Source.3990: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.3991: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.3992: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3993: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.3994: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.3995: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.3996: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.3997: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.3998: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.3999: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.4000: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.4001: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.4002: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5
Source.4003: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.4004: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.4005: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.4006: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.4007: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.4008: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.4009: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.4010: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.4011: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.4012: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.4013: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.4014: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.4015: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.4016: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.4017: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.4018: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.4019: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.4020: DFBPPR10954 ---- Animal proteins ---- Protein max
Source.4021: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.4022: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate
Source.4023: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.4024: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.4025: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.4026: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.4027: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.4028: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.4029: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.4030: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.4031: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.4032: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.4033: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.4034: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.4035: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.4036: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.4037: DFBPPR11007 ---- Animal proteins ---- Anamorsin
Source.4038: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.4039: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.4040: DFBPPR11016 ---- Animal proteins ---- Protein lin-7 homolog C
Source.4041: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1
Source.4042: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.4043: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.4044: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.4045: DFBPPR11035 ---- Animal proteins ---- Protein Dr1
Source.4046: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.4047: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.4048: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.4049: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2
Source.4050: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.4051: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.4052: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.4053: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.4054: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.4055: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.4056: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.4057: DFBPPR11098 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.4058: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.4059: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.4060: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.4061: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.4062: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.4063: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.4064: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.4065: DFBPPR11126 ---- Animal proteins ---- Parvalbumin, thymic
Source.4066: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.4067: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.4068: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.4069: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.4070: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.4071: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.4072: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.4073: DFBPPR11146 ---- Animal proteins ---- Formin
Source.4074: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.4075: DFBPPR11148 ---- Animal proteins ---- Pro-thyrotropin-releasing hormone
Source.4076: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.4077: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.4078: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.4079: DFBPPR11165 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF185
Source.4080: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4081: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.4082: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.4083: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.4084: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.4085: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.4086: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.4087: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.4088: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.4089: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.4090: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.4091: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.4092: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.4093: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone
Source.4094: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.4095: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.4096: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.4097: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.4098: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.4099: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.4100: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.4101: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.4102: DFBPPR11241 ---- Animal proteins ---- Lymphocyte antigen 6E
Source.4103: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.4104: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.4105: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.4106: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.4107: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.4108: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.4109: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.4110: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.4111: DFBPPR11283 ---- Animal proteins ---- Centromere protein U
Source.4112: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.4113: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.4114: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.4115: DFBPPR11299 ---- Animal proteins ---- Casein kinase II subunit beta
Source.4116: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.4117: DFBPPR11312 ---- Animal proteins ---- Transcription factor MafK
Source.4118: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.4119: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42
Source.4120: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.4121: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.4122: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.4123: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.4124: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.4125: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.4126: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.4127: DFBPPR11355 ---- Animal proteins ---- Collectin-10
Source.4128: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR
Source.4129: DFBPPR11359 ---- Animal proteins ---- Mesogenin-1
Source.4130: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.4131: DFBPPR11371 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.4132: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.4133: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.4134: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.4135: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.4136: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4137: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.4138: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.4139: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.4140: DFBPPR11401 ---- Animal proteins ---- Inhibitor of growth protein 3
Source.4141: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.4142: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.4143: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.4144: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.4145: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.4146: DFBPPR11427 ---- Animal proteins ---- Protein Abitram
Source.4147: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.4148: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.4149: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.4150: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.4151: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.4152: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2
Source.4153: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.4154: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.4155: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.4156: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.4157: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.4158: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.4159: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.4160: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.4161: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.4162: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.4163: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.4164: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X
Source.4165: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein
Source.4166: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.4167: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.4168: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.4169: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.4170: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1
Source.4171: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.4172: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.4173: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.4174: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4175: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.4176: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.4177: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.4178: DFBPPR11526 ---- Animal proteins ---- Fibromodulin
Source.4179: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.4180: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.4181: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.4182: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.4183: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.4184: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.4185: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.4186: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.4187: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.4188: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.4189: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.4190: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.4191: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.4192: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.4193: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.4194: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.4195: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.4196: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.4197: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.4198: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.4199: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.4200: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.4201: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.4202: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.4203: DFBPPR11598 ---- Animal proteins ---- Cellular nucleic acid-binding protein
Source.4204: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.4205: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.4206: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.4207: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.4208: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.4209: DFBPPR11623 ---- Animal proteins ---- Polyadenylate-binding protein-interacting protein 2
Source.4210: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.4211: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.4212: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.4213: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.4214: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.4215: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4216: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.4217: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.4218: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.4219: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.4220: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.4221: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.4222: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.4223: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.4224: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.4225: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.4226: DFBPPR11685 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.4227: DFBPPR11690 ---- Animal proteins ---- CDC42 small effector protein 1
Source.4228: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7
Source.4229: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.4230: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.4231: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.4232: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.4233: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.4234: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.4235: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.4236: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8
Source.4237: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.4238: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.4239: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.4240: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.4241: DFBPPR11736 ---- Animal proteins ---- Ig lambda chain V-1 region
Source.4242: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.4243: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.4244: DFBPPR11741 ---- Animal proteins ---- Parvalbumin, thymic CPV3
Source.4245: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.4246: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1
Source.4247: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.4248: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.4249: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.4250: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.4251: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15
Source.4252: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.4253: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.4254: DFBPPR11768 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.4255: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.4256: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.4257: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.4258: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3
Source.4259: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.4260: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.4261: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.4262: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.4263: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.4264: DFBPPR11797 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.4265: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.4266: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.4267: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.4268: DFBPPR11806 ---- Animal proteins ---- Homeobox protein Hox-B6
Source.4269: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.4270: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.4271: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.4272: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1
Source.4273: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.4274: DFBPPR11814 ---- Animal proteins ---- Centromere protein R
Source.4275: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.4276: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.4277: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.4278: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.4279: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.4280: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.4281: DFBPPR11831 ---- Animal proteins ---- Protein lin-28 homolog B
Source.4282: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.4283: DFBPPR11838 ---- Animal proteins ---- Enhancer of mRNA-decapping protein 3
Source.4284: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.4285: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82
Source.4286: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.4287: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.4288: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.4289: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.4290: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.4291: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.4292: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.4293: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.4294: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.4295: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.4296: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.4297: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.4298: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.4299: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.4300: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna
Source.4301: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.4302: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.4303: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.4304: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.4305: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.4306: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.4307: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.4308: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.4309: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.4310: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.4311: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.4312: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.4313: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.4314: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.4315: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor
Source.4316: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.4317: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.4318: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.4319: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.4320: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.4321: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.4322: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.4323: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.4324: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.4325: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.4326: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.4327: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.4328: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.4329: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog
Source.4330: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.4331: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1
Source.4332: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.4333: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.4334: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.4335: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.4336: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein
Source.4337: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.4338: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.4339: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.4340: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog
Source.4341: DFBPPR12022 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.4342: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.4343: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.4344: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.4345: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.4346: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.4347: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.4348: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.4349: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.4350: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.4351: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.4352: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.4353: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.4354: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.4355: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.4356: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.4357: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.4358: DFBPPR12096 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 4
Source.4359: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.4360: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.4361: DFBPPR12100 ---- Animal proteins ---- Centromere protein Q
Source.4362: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.4363: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.4364: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.4365: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.4366: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.4367: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.4368: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.4369: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.4370: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.4371: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.4372: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.4373: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.4374: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.4375: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.4376: DFBPPR12158 ---- Animal proteins ---- Protein CDV3 homolog
Source.4377: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.4378: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.4379: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.4380: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.4381: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.4382: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.4383: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.4384: DFBPPR12189 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.4385: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A
Source.4386: DFBPPR12198 ---- Animal proteins ---- RING finger protein 141
Source.4387: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.4388: DFBPPR12208 ---- Animal proteins ---- Protein FAM76A
Source.4389: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.4390: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.4391: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.4392: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.4393: DFBPPR12236 ---- Animal proteins ---- Protein FAM133
Source.4394: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.4395: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like
Source.4396: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.4397: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog
Source.4398: DFBPPR12246 ---- Animal proteins ---- Uncharacterized protein KIAA1143 homolog
Source.4399: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.4400: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.4401: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin
Source.4402: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.4403: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.4404: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.4405: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.4406: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.4407: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.4408: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4409: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.4410: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.4411: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.4412: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.4413: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.4414: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.4415: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.4416: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4417: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.4418: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.4419: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.4420: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.4421: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.4422: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.4423: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.4424: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.4425: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.4426: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.4427: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.4428: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4429: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.4430: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.4431: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.4432: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.4433: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.4434: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.4435: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.4436: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.4437: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.4438: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.4439: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.4440: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.4441: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.4442: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.4443: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.4444: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4445: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.4446: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.4447: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.4448: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.4449: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.4450: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.4451: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.4452: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.4453: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.4454: DFBPPR12508 ---- Animal proteins ---- Interleukin-2
Source.4455: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.4456: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.4457: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.4458: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.4459: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.4460: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.4461: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4462: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.4463: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.4464: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase
Source.4465: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.4466: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4467: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.4468: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14
Source.4469: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.4470: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.4471: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I
Source.4472: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.4473: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.4474: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.4475: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.4476: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.4477: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4478: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4479: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.4480: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.4481: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.4482: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4483: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4484: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.4485: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.4486: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.4487: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.4488: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.4489: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.4490: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.4491: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.4492: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.4493: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.4494: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.4495: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.4496: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.4497: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.4498: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.4499: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma
Source.4500: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.4501: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.4502: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.4503: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.4504: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.4505: DFBPPR12836 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.4506: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.4507: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.4508: DFBPPR12848 ---- Animal proteins ---- Sarcoplasmic reticulum histidine-rich calcium-binding protein
Source.4509: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor
Source.4510: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.4511: DFBPPR12863 ---- Animal proteins ---- Casein kinase II subunit beta
Source.4512: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4513: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.4514: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.4515: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.4516: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.4517: DFBPPR12918 ---- Animal proteins ---- Myosin heavy chain, embryonic smooth muscle isoform
Source.4518: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.4519: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.4520: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.4521: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.4522: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.4523: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4524: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.4525: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.4526: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.4527: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.4528: DFBPPR12967 ---- Animal proteins ---- Beta-sarcoglycan
Source.4529: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.4530: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.4531: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.4532: DFBPPR12979 ---- Animal proteins ---- Lutropin subunit beta
Source.4533: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.4534: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4535: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.4536: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.4537: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.4538: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.4539: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform
Source.4540: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.4541: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A
Source.4542: DFBPPR13034 ---- Animal proteins ---- Sarcospan
Source.4543: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.4544: DFBPPR13041 ---- Animal proteins ---- Fibromodulin
Source.4545: DFBPPR13043 ---- Animal proteins ---- Whey acidic protein
Source.4546: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein
Source.4547: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein
Source.4548: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.4549: DFBPPR13067 ---- Animal proteins ---- Beta-casein
Source.4550: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4551: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.4552: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2
Source.4553: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.4554: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region
Source.4555: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region
Source.4556: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.4557: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.4558: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain
Source.4559: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.4560: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4561: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.4562: DFBPPR13166 ---- Animal proteins ---- CD44 antigen
Source.4563: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.4564: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.4565: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.4566: DFBPPR13188 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2
Source.4567: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.4568: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.4569: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4570: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.4571: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.4572: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.4573: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.4574: DFBPPR13224 ---- Animal proteins ---- Prorelaxin
Source.4575: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta
Source.4576: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.4577: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4578: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.4579: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2
Source.4580: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.4581: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.4582: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4583: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.4584: DFBPPR13264 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.4585: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.4586: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.4587: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.4588: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I
Source.4589: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.4590: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0
Source.4591: DFBPPR13326 ---- Animal proteins ---- Interferon alpha-1
Source.4592: DFBPPR13328 ---- Animal proteins ---- Interferon alpha-2
Source.4593: DFBPPR13332 ---- Animal proteins ---- Interferon alpha-3
Source.4594: DFBPPR13333 ---- Animal proteins ---- Interferon alpha-4
Source.4595: DFBPPR13343 ---- Animal proteins ---- Interferon omega-1
Source.4596: DFBPPR13344 ---- Animal proteins ---- Interferon omega-2
Source.4597: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.4598: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.4599: DFBPPR13361 ---- Animal proteins ---- Protein S100-G
Source.4600: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4601: DFBPPR13370 ---- Animal proteins ---- Interleukin-2
Source.4602: DFBPPR13390 ---- Animal proteins ---- C-X-C motif chemokine 6
Source.4603: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.4604: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4605: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22
Source.4606: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4607: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor
Source.4608: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.4609: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4610: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.4611: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.4612: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.4613: DFBPPR13443 ---- Animal proteins ---- Kit ligand
Source.4614: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I
Source.4615: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4616: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4617: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.4618: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.4619: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.4620: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.4621: DFBPPR13512 ---- Animal proteins ---- Interleukin-2
Source.4622: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.4623: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4624: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.4625: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.4626: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4627: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.4628: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.4629: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor
Source.4630: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.4631: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4632: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.4633: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.4634: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4635: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.4636: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.4637: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor
Source.4638: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.4639: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.4640: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4641: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4642: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.4643: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.4644: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.4645: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.4646: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11
Source.4647: DFBPPR13654 ---- Animal proteins ---- Corticoliberin
Source.4648: DFBPPR13664 ---- Animal proteins ---- Interleukin-10
Source.4649: DFBPPR13665 ---- Animal proteins ---- Kit ligand
Source.4650: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.4651: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I
Source.4652: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.4653: DFBPPR13686 ---- Animal proteins ---- Vimentin
Source.4654: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.4655: DFBPPR13708 ---- Animal proteins ---- Renin
Source.4656: DFBPPR13709 ---- Animal proteins ---- Pro-glucagon
Source.4657: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.4658: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.4659: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.4660: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4661: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4662: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4663: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.4664: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.4665: DFBPPR13763 ---- Animal proteins ---- Interleukin-2
Source.4666: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4667: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.4668: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.4669: DFBPPR13777 ---- Animal proteins ---- Centromere protein C
Source.4670: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.4671: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.4672: DFBPPR13824 ---- Animal proteins ---- Adrenodoxin
Source.4673: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.4674: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.4675: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.4676: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.4677: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.4678: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3
Source.4679: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.4680: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.4681: DFBPPR13935 ---- Animal proteins ---- Major centromere autoantigen B
Source.4682: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4683: DFBPPR13945 ---- Animal proteins ---- Keratin, ultra high-sulfur matrix protein
Source.4684: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4685: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.4686: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.4687: DFBPPR13959 ---- Animal proteins ---- Calpastatin
Source.4688: DFBPPR13979 ---- Animal proteins ---- Putative uncharacterized protein Z
Source.4689: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.4690: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.4691: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.4692: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.4693: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.4694: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4695: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.4696: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.4697: DFBPPR14043 ---- Animal proteins ---- Prolactin
Source.4698: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.4699: DFBPPR14073 ---- Marine protein ---- Elastase-1
Source.4700: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.4701: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.4702: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.4703: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.4704: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.4705: DFBPPR14102 ---- Marine protein ---- Anamorsin-B
Source.4706: DFBPPR14104 ---- Marine protein ---- Anamorsin-A
Source.4707: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146
Source.4708: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.4709: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.4710: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.4711: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H
Source.4712: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.4713: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.4714: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.4715: DFBPPR14174 ---- Marine protein ---- Ubiquitin-fold modifier 1
Source.4716: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.4717: DFBPPR14187 ---- Marine protein ---- Secreted phosphoprotein 24
Source.4718: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.4719: DFBPPR14192 ---- Marine protein ---- Homeobox protein Hox-A7
Source.4720: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.4721: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.4722: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A
Source.4723: DFBPPR14206 ---- Marine protein ---- Intraflagellar transport protein 43 homolog B
Source.4724: DFBPPR14207 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.4725: DFBPPR14208 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.4726: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.4727: DFBPPR14244 ---- Marine protein ---- Protamine
Source.4728: DFBPPR14251 ---- Marine protein ---- Isotocin-neurophysin IT 1
Source.4729: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.4730: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.4731: DFBPPR14307 ---- Marine protein ---- Uncharacterized protein ycf83
Source.4732: DFBPPR14311 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic
Source.4733: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4734: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.4735: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.4736: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4737: DFBPPR14346 ---- Marine protein ---- R-phycoerythrin alpha chain
Source.4738: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.4739: DFBPPR14400 ---- Marine protein ---- Heme oxygenase
Source.4740: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.4741: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26
Source.4742: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.4743: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.4744: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1
Source.4745: DFBPPR14466 ---- Marine protein ---- 30S ribosomal protein S11, chloroplastic
Source.4746: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28
Source.4747: DFBPPR14494 ---- Marine protein ---- 50S ribosomal protein L35, chloroplastic
Source.4748: DFBPPR14496 ---- Marine protein ---- 50S ribosomal protein L29, chloroplastic
Source.4749: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.4750: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92
Source.4751: DFBPPR14529 ---- Marine protein ---- Uncharacterized protein ycf22
Source.4752: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.4753: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.4754: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.4755: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.4756: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.4757: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.4758: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.4759: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.4760: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4761: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.4762: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.4763: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.4764: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.4765: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.4766: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.4767: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.4768: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.4769: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.4770: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a
Source.4771: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.4772: DFBPPR14619 ---- Marine protein ---- Protamine-2B
Source.4773: DFBPPR14620 ---- Marine protein ---- GTP cyclohydrolase 1
Source.4774: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.4775: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18
Source.4776: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.4777: DFBPPR14637 ---- Marine protein ---- Protamine TP16
Source.4778: DFBPPR14639 ---- Marine protein ---- Protamine TP17
Source.4779: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.4780: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.4781: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.4782: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.4783: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc
Source.4784: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.4785: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.4786: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.4787: DFBPPR14689 ---- Marine protein ---- Protamine-1A
Source.4788: DFBPPR14690 ---- Marine protein ---- Protamine-1B
Source.4789: DFBPPR14691 ---- Marine protein ---- Protamine-2
Source.4790: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2
Source.4791: DFBPPR14693 ---- Marine protein ---- Protamine-3A
Source.4792: DFBPPR14694 ---- Marine protein ---- Protamine-2A
Source.4793: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64
Source.4794: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.4795: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.4796: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.4797: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.4798: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.4799: DFBPPR14737 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.4800: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.4801: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.4802: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.4803: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.4804: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.4805: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.4806: DFBPPR14787 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform A
Source.4807: DFBPPR14792 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform B
Source.4808: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.4809: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.4810: DFBPPR14874 ---- Marine protein ---- Prolactin
Source.4811: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.4812: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.4813: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.4814: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.4815: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.4816: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.4817: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.4818: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.4819: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.4820: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.4821: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.4822: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.4823: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.4824: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.4825: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.4826: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.4827: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.4828: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.4829: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.4830: DFBPPR14952 ---- Microorganism protein ---- Histone H2B.1
Source.4831: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.4832: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.4833: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.4834: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.4835: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.4836: DFBPPR14967 ---- Microorganism protein ---- Histone H2B.2
Source.4837: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.4838: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.4839: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.4840: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.4841: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit
Source.4842: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.4843: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.4844: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.4845: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.4846: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.4847: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.4848: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.4849: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.4850: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.4851: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.4852: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.4853: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1
Source.4854: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.4855: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.4856: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.4857: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.4858: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.4859: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.4860: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.4861: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1
Source.4862: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.4863: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.4864: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor
Source.4865: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.4866: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.4867: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.4868: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.4869: DFBPPR15089 ---- Microorganism protein ---- F-actin-capping protein subunit beta
Source.4870: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.4871: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11
Source.4872: DFBPPR15103 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein END3
Source.4873: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.4874: DFBPPR15106 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.4875: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.4876: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.4877: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.4878: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.4879: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.4880: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.4881: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.4882: DFBPPR15133 ---- Microorganism protein ---- Iron sulfur cluster assembly protein 1, mitochondrial
Source.4883: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6
Source.4884: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.4885: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.4886: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.4887: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.4888: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.4889: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.4890: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2
Source.4891: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1
Source.4892: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.4893: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.4894: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.4895: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.4896: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.4897: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.4898: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.4899: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.4900: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.4901: DFBPPR15222 ---- Microorganism protein ---- DASH complex subunit ASK1
Source.4902: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.4903: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.4904: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.4905: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.4906: DFBPPR15252 ---- Microorganism protein ---- Protein DSE2
Source.4907: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1
Source.4908: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.4909: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.4910: DFBPPR15262 ---- Microorganism protein ---- Inner kinetochore subunit NKP1
Source.4911: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.4912: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.4913: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.4914: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.4915: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.4916: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.4917: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta
Source.4918: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.4919: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.4920: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.4921: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.4922: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.4923: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3
Source.4924: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.4925: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.4926: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.4927: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.4928: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.4929: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.4930: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.4931: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.4932: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.4933: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.4934: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.4935: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.4936: DFBPPR15403 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM13
Source.4937: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71
Source.4938: DFBPPR15415 ---- Microorganism protein ---- Transcription initiation factor TFIID subunit 4
Source.4939: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16
Source.4940: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.4941: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.4942: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3
Source.4943: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.4944: DFBPPR15437 ---- Microorganism protein ---- Ubiquitin-like-conjugating enzyme ATG10
Source.4945: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.4946: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.4947: DFBPPR15441 ---- Microorganism protein ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.4948: DFBPPR15442 ---- Microorganism protein ---- Type 1 phosphatases regulator YPI1
Source.4949: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.4950: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.4951: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.4952: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.4953: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.4954: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4
Source.4955: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.4956: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.4957: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.4958: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1
Source.4959: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.4960: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.4961: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.4962: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.4963: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.4964: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.4965: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.4966: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.4967: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.4968: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.4969: DFBPPR15510 ---- Microorganism protein ---- Autophagy-related protein 29
Source.4970: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.4971: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.4972: DFBPPR15517 ---- Microorganism protein ---- rRNA biogenesis protein RRP36
Source.4973: DFBPPR15518 ---- Microorganism protein ---- Chromatin modification-related protein EAF6
Source.4974: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.4975: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.4976: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta
Source.4977: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.4978: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.4979: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6
Source.4980: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.4981: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.4982: DFBPPR15554 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 22
Source.4983: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.4984: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.4985: DFBPPR15568 ---- Microorganism protein ---- Probable kinetochore protein SPC24
Source.4986: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381
Source.4987: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.4988: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.4989: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.4990: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.4991: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.4992: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.4993: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.4994: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.4995: DFBPPR15608 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP2
Source.4996: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.4997: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.4998: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5
Source.4999: DFBPPR15617 ---- Microorganism protein ---- Cap-associated protein CAF20
Source.5000: DFBPPR15618 ---- Microorganism protein ---- Ribosome assembly protein 3
Source.5001: DFBPPR15624 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit VAB2
Source.5002: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.5003: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.5004: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.5005: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3
Source.5006: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3
Source.5007: DFBPPR15651 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 34, mitochondrial
Source.5008: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1
Source.5009: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.5010: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.5011: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1
Source.5012: DFBPPR15664 ---- Microorganism protein ---- Spindle pole body component SPC42
Source.5013: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.5014: DFBPPR15674 ---- Microorganism protein ---- DNA polymerase epsilon subunit C
Source.5015: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.5016: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.5017: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.5018: DFBPPR15689 ---- Microorganism protein ---- Ribosomal protein VAR1, mitochondrial
Source.5019: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4
Source.5020: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.5021: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.5022: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.5023: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1
Source.5024: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.5025: DFBPPR15702 ---- Microorganism protein ---- Protein FYV4, mitochondrial
Source.5026: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45
Source.5027: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.5028: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.5029: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.5030: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.5031: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1
Source.5032: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.5033: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.5034: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.5035: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.5036: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.5037: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19
Source.5038: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.5039: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.5040: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.5041: DFBPPR15746 ---- Microorganism protein ---- Topoisomerase I damage affected protein 11
Source.5042: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.5043: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.5044: DFBPPR15758 ---- Microorganism protein ---- Required for respiratory growth protein 8, mitochondrial
Source.5045: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.5046: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.5047: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.5048: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.5049: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.5050: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4
Source.5051: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.5052: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.5053: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.5054: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.5055: DFBPPR15803 ---- Microorganism protein ---- Galactokinase
Source.5056: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.5057: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.5058: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.5059: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.5060: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.5061: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.5062: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.5063: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.5064: DFBPPR15880 ---- Microorganism protein ---- 40S ribosomal protein S13
Source.5065: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.5066: DFBPPR15886 ---- Microorganism protein ---- Capsid protein
Source.5067: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.5068: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.5069: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.5070: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.5071: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.5072: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.5073: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.5074: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.5075: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.5076: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.5077: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.5078: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.5079: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.5080: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic
Source.5081: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.5082: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.5083: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.5084: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.5085: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.5086: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.5087: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.5088: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.5089: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.5090: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.5091: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5092: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.5093: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.5094: DFBPPR7819 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.5095: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5096: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.5097: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.5098: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5099: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.5100: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2
Source.5101: DFBPPR7870 ---- Plant protein ---- Translation initiation factor IF-1, chloroplastic
Source.5102: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.5103: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.5104: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.5105: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.5106: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.5107: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1
Source.5108: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.5109: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.5110: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.5111: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.5112: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.5113: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.5114: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1
Source.5115: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.5116: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.5117: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.5118: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.5119: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.5120: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.5121: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.5122: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.5123: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.5124: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.5125: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1
Source.5126: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.5127: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.5128: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.5129: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.5130: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.5131: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.5132: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4
Source.5133: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.5134: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.5135: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.5136: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.5137: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.5138: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.5139: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.5140: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5141: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.5142: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.5143: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5
Source.5144: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.5145: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.5146: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.5147: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.5148: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.5149: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.5150: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5151: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.5152: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.5153: DFBPPR8235 ---- Plant protein ---- Catalase
Source.5154: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.5155: DFBPPR8247 ---- Plant protein ---- Nucleoside diphosphate kinase
Source.5156: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.5157: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.5158: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5159: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.5160: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.5161: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.5162: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.5163: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.5164: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.5165: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5166: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.5167: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.5168: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Source.5169: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein
Source.5170: DFBPPR8352 ---- Plant protein ---- Putative uncharacterized protein ycf15
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Stimulating activity

The release of vasoactive substances, 6-keto-prostaglandin F (stable marker of prostaglandin I2), endothelin-1, was significantly influenced by the incubation with the peptide SSS compared with control cells (P < 0.05), as shown in Table 1.

Table 1 Relative concentrations of vasoactive substances per milligram of cell protein in cell medium of human aortic endothelial cells treated with various di- and tripeptides compared to untreated cells a.
Peptides
ConcentrationRelative concentration of vasoactive substances (% of control)
TXB2
(control = 100 ± 11)
6-keto-PGF
(control = 105 ± 15)
ET-1
(control = 100 ± 19)
NO
(control = 100 ± 29)
H-Ser-Ser-Ser-OH
100 nM100 ± 10
146 ± 20*
113 ± 2*
108 ± 25
50 μM106 ± 13
121 ± 47
118 ± 2*
105 ± 7
a Results are means ± SD for n=6.
* Different from untreated cells; P < 0.05.
Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

Tripeptides were purchased from BACHEM (Bubendorf, Schweiz).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report:

Cell viability was not affected by incubation with tripeptides at concentrations ranging from 1 nM to 1 mM but was reduced at 10 mM compared to untreated cells (data not shown).

Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
BIOPEP-UWM [D1] 3355
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Ringseis R, Matthes B, Lehmann V, Becker K, Schöps R, Ulbrich-Hofmann R, Eder K. Peptides and hydrolysates from casein and soy protein modulate the release of vasoactive substances from human aortic endothelial cells. Biochim Biophys Acta. 2005 Jan 18;1721(1-3):89-97.
PMID: 15652183
Other literature(s) N.D
PubDate 2005
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214