E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0457(Multifunctional peptide)
DFBP ID DFBPMUFU0457
Peptide sequence RW
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 3
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI1613 Synthesis peptide Synthesis peptide

N.D

Antioxidative peptides
DFBPID Organism Precursor protein Residue position
DFBPANOX0784 Egg white protein Ovotransferrin

N.D

Other bioactive peptides
DFBPID Organism Precursor protein Residue position
DFBPINPE0015 Synthesis Synthesis peptide

N.D

Physical & computational properties
Three-letter amino acid Arg-Trp
Single-letter amino acid RW
Peptide length 2
Theoretical mass 360.41 Da c
Net charge 0.00 c
Isoelectric point (pI) 11.04 c
GRAVY -2.7000
Hydrophilic residue ratio 50%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein
Source.3: DFBPPR0748 ---- Plant proteins ---- Agglutinin
Source.4: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.5: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.6: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.7: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.8: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.9: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.10: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.11: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.12: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.13: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.14: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.15: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.16: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.17: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.18: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.19: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.20: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.21: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.22: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.23: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.24: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.25: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.26: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.27: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.28: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.29: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.30: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.31: DFBPPR0876 ---- Plant proteins ---- Protein BZR1 homolog 1
Source.32: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.33: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.34: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.35: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.36: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.37: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.38: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.39: DFBPPR0930 ---- Plant proteins ---- Abscisic acid receptor PYL3
Source.40: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.41: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.42: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.43: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.44: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.45: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.46: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.47: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.48: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.49: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.50: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.51: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.52: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.53: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.54: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.55: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.56: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.57: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.58: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.59: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.60: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.61: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.62: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.63: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.64: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.65: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.66: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.67: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.68: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.69: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.70: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.71: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.72: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.73: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.74: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.75: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.76: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.77: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.78: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.79: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.80: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.81: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.82: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.83: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.84: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.85: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.86: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.87: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.88: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.89: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.90: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.91: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.92: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.93: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.94: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.95: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.96: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.97: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.98: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.99: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.100: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.101: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.102: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3
Source.103: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.104: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.105: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.106: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.107: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.108: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.109: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.110: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.111: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.112: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.113: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.114: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog
Source.115: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.116: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.117: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.118: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.119: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.120: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.121: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.122: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.123: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.124: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.125: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.126: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.127: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.128: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.129: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial
Source.130: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.131: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.132: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.133: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.134: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.135: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.136: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.137: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.138: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.139: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.140: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.141: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2
Source.142: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.143: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.144: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.145: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.146: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.147: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.148: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.149: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.150: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.151: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.152: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.153: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.154: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.155: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.156: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic
Source.157: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.158: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.159: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.160: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.161: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.162: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.163: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.164: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.165: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.166: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.167: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.168: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.169: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.170: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.171: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.172: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.173: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.174: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.175: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.176: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.177: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.178: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.179: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.180: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.181: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.182: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.183: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.184: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.185: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.186: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.187: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.188: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.189: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.190: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.191: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.192: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.193: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.194: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.195: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.196: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.197: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.198: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.199: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.200: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.201: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.202: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.203: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.204: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.205: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.206: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.207: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.208: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.209: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.210: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.211: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.212: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.213: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.214: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.215: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.216: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.217: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.218: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.219: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.220: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.221: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.222: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.223: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.224: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.225: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.226: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.227: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.228: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.229: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.230: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.231: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.232: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.233: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.234: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.235: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.236: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.237: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.238: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.239: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.240: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.241: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.242: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.243: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.244: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.245: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.246: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.247: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.248: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.249: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.250: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.251: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.252: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.253: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.254: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.255: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.256: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.257: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.258: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.259: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.260: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.261: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a
Source.262: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.263: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.264: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.265: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.266: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.267: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.268: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.269: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.270: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog
Source.271: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.272: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.273: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.274: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.275: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.276: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.277: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.278: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.279: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.280: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.281: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.282: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.283: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.284: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.285: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.286: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.287: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.288: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.289: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.290: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.291: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.292: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.293: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.294: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.295: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.296: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.297: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.298: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.299: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.300: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.301: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.302: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.303: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.304: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.305: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.306: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.307: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.308: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.309: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.310: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.311: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.312: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.313: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.314: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.315: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.316: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.317: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.318: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.319: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.320: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.321: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.322: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.323: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.324: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1
Source.325: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.326: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.327: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.328: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.329: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.330: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.331: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.332: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.333: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.334: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.335: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.336: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.337: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.338: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.339: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.340: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.341: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.342: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.343: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.344: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.345: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.346: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.347: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.348: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.349: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.350: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.351: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.352: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.353: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.354: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.355: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.356: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.357: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.358: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.359: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.360: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.361: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.362: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.363: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.364: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.365: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.366: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.367: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.368: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.369: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.370: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.371: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.372: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.373: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.374: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.375: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.376: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.377: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1
Source.378: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.379: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30
Source.380: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.381: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.382: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.383: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.384: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.385: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.386: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.387: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.388: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.389: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1
Source.390: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.391: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.392: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.393: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.394: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.395: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.396: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.397: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.398: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.399: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.400: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.401: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.402: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein
Source.403: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.404: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.405: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.406: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.407: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.408: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.409: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.410: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.411: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.412: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.413: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.414: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.415: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.416: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.417: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.418: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80
Source.419: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.420: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.421: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.422: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.423: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.424: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.425: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.426: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.427: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1
Source.428: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.429: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.430: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.431: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.432: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.433: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.434: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.435: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.436: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.437: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.438: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.439: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.440: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.441: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.442: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.443: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.444: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.445: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.446: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.447: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.448: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.449: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.450: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.451: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.452: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.453: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.454: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.455: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.456: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial
Source.457: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.458: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.459: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.460: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.461: DFBPPR2216 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 1
Source.462: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.463: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.464: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.465: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.466: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.467: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.468: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.469: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.470: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.471: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.472: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.473: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.474: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.475: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.476: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.477: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.478: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.479: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.480: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.481: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.482: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.483: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.484: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.485: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.486: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.487: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.488: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.489: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.490: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.491: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.492: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.493: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.494: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.495: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.496: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.497: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.498: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.499: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.500: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.501: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.502: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.503: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.504: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.505: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.506: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.507: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.508: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.509: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.510: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.511: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.512: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.513: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.514: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.515: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.516: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.517: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.518: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.519: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.520: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.521: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.522: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.523: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.524: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.525: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.526: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.527: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.528: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.529: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.530: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.531: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B
Source.532: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.533: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.534: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.535: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.536: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.537: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.538: DFBPPR2460 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.539: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.540: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.541: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.542: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.543: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.544: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2
Source.545: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.546: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.547: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.548: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.549: DFBPPR2518 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 2
Source.550: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.551: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.552: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.553: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.554: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.555: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.556: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.557: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.558: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.559: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.560: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.561: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.562: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.563: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.564: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.565: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9
Source.566: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.567: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.568: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.569: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.570: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.571: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.572: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.573: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.574: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.575: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.576: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.577: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.578: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.579: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.580: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.581: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.582: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.583: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.584: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.585: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.586: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.587: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.588: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.589: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.590: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.591: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.592: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.593: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.594: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.595: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.596: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.597: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.598: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.599: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.600: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.601: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.602: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.603: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1
Source.604: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.605: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.606: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.607: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.608: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.609: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.610: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.611: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.612: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.613: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.614: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.615: DFBPPR2754 ---- Plant proteins ---- Adenylate kinase 3
Source.616: DFBPPR2755 ---- Plant proteins ---- Adenylate kinase 4
Source.617: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.618: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.619: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.620: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.621: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.622: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.623: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.624: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.625: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.626: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.627: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.628: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.629: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.630: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.631: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.632: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.633: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.634: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.635: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.636: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.637: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.638: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.639: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.640: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.641: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.642: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.643: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.644: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.645: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.646: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.647: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.648: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.649: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.650: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.651: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.652: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.653: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.654: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.655: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.656: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.657: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.658: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.659: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.660: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.661: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.662: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1
Source.663: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.664: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.665: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.666: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.667: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.668: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.669: DFBPPR2939 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 5
Source.670: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.671: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.672: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.673: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.674: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21
Source.675: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.676: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.677: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.678: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.679: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.680: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.681: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23
Source.682: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.683: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.684: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.685: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.686: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.687: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20
Source.688: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.689: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.690: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.691: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.692: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.693: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.694: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.695: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.696: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.697: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.698: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.699: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.700: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.701: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36
Source.702: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.703: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.704: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.705: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.706: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.707: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.708: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.709: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.710: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.711: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.712: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.713: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.714: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.715: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.716: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.717: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.718: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.719: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.720: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.721: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.722: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.723: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.724: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.725: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.726: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.727: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.728: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20
Source.729: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.730: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.731: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.732: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.733: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.734: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.735: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.736: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.737: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.738: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.739: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.740: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.741: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.742: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.743: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.744: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.745: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.746: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.747: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic
Source.748: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.749: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.750: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.751: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.752: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.753: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.754: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.755: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.756: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.757: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.758: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.759: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.760: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.761: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.762: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.763: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.764: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.765: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.766: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.767: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.768: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.769: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.770: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.771: DFBPPR3257 ---- Plant proteins ---- Ras-related protein RIC2
Source.772: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.773: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.774: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.775: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.776: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.777: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.778: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.779: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.780: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.781: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.782: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.783: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.784: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.785: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.786: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.787: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.788: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.789: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.790: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.791: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.792: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.793: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.794: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.795: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.796: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.797: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.798: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.799: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.800: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.801: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.802: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.803: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.804: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.805: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.806: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.807: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.808: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.809: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.810: DFBPPR3418 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 3
Source.811: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.812: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.813: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.814: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.815: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.816: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.817: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.818: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.819: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.820: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.821: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.822: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.823: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.824: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.825: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.826: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.827: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.828: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1
Source.829: DFBPPR3510 ---- Plant proteins ---- Thioredoxin-like protein Clot
Source.830: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.831: DFBPPR3526 ---- Plant proteins ---- Protein XAP5 CIRCADIAN TIMEKEEPER
Source.832: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.833: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.834: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.835: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.836: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.837: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.838: DFBPPR3547 ---- Plant proteins ---- Probable BRI1 kinase inhibitor 1
Source.839: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.840: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.841: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.842: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.843: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.844: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.845: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.846: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.847: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.848: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.849: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.850: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.851: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.852: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.853: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.854: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.855: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic
Source.856: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.857: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.858: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.859: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.860: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.861: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.862: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.863: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.864: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.865: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.866: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.867: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.868: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.869: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.870: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.871: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.872: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.873: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB
Source.874: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.875: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.876: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.877: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.878: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.879: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.880: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1
Source.881: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.882: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.883: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.884: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.885: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.886: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.887: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.888: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.889: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.890: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.891: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.892: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.893: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.894: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.895: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.896: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.897: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.898: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.899: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.900: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.901: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial
Source.902: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.903: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.904: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.905: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.906: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.907: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.908: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.909: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.910: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.911: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.912: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.913: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.914: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.915: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.916: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.917: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.918: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.919: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.920: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.921: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.922: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.923: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.924: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.925: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.926: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.927: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.928: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.929: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.930: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.931: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.932: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.933: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.934: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.935: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.936: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.937: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.938: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.939: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.940: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.941: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.942: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1
Source.943: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.944: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.945: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.946: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.947: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.948: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.949: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.950: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7
Source.951: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.952: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.953: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.954: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.955: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.956: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.957: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.958: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.959: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.960: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.961: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.962: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.963: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.964: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.965: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.966: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.967: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.968: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.969: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.970: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.971: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.972: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.973: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.974: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.975: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.976: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D
Source.977: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.978: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.979: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.980: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.981: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.982: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.983: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.984: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.985: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.986: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.987: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.988: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.989: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.990: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.991: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.992: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.993: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.994: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.995: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.996: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.997: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.998: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.999: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.1000: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.1001: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.1002: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.1003: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1004: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.1005: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1006: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.1007: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1008: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1009: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1010: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1011: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2
Source.1012: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.1013: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.1014: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6
Source.1015: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.1016: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.1017: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1018: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63
Source.1019: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1020: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1021: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.1022: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.1023: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1024: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.1025: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1026: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.1027: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1028: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3
Source.1029: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.1030: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.1031: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.1032: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1033: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.1034: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6
Source.1035: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.1036: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.1037: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.1038: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.1039: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.1040: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1041: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.1042: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1043: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.1044: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.1045: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1046: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.1047: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1048: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.1049: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.1050: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1
Source.1051: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1052: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1053: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.1054: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5
Source.1055: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.1056: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1057: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.1058: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25
Source.1059: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.1060: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.1061: DFBPPR4417 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 3
Source.1062: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1063: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.1064: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1065: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1066: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.1067: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.1068: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1069: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.1070: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.1071: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.1072: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.1073: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.1074: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2
Source.1075: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.1076: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.1077: DFBPPR4454 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1078: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.1079: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1080: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.1081: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.1082: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.1083: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.1084: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.1085: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.1086: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.1087: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1088: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.1089: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.1090: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.1091: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.1092: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.1093: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1094: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1095: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.1096: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.1097: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1098: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.1099: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.1100: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.1101: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.1102: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.1103: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.1104: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.1105: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.1106: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1
Source.1107: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.1108: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.1109: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.1110: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1111: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.1112: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.1113: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1114: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.1115: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.1116: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.1117: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.1118: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.1119: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.1120: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.1121: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.1122: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.1123: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.1124: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.1125: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.1126: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.1127: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1128: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.1129: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.1130: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1131: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3
Source.1132: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.1133: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5
Source.1134: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1135: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.1136: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.1137: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.1138: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.1139: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.1140: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1141: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1142: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.1143: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.1144: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.1145: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.1146: DFBPPR4786 ---- Plant proteins ---- B3 domain-containing protein Os12g0592300
Source.1147: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.1148: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.1149: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34
Source.1150: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.1151: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.1152: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.1153: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.1154: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1155: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.1156: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.1157: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.1158: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.1159: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090
Source.1160: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.1161: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.1162: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100
Source.1163: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1164: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1165: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1166: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.1167: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.1168: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1169: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.1170: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1171: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.1172: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.1173: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.1174: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.1175: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.1176: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.1177: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1178: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1179: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.1180: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.1181: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1182: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.1183: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.1184: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.1185: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.1186: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1187: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.1188: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.1189: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.1190: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.1191: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.1192: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1193: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.1194: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1195: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1196: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1197: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1198: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1199: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1200: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.1201: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.1202: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.1203: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.1204: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.1205: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.1206: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1207: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1208: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.1209: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.1210: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1211: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.1212: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.1213: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.1214: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1215: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.1216: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.1217: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1218: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.1219: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1220: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1221: DFBPPR5105 ---- Plant proteins ---- Probable bifunctional TENA-E protein
Source.1222: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.1223: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.1224: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.1225: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1226: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1227: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.1228: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.1229: DFBPPR5146 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1230: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1231: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1232: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1233: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1234: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.1235: DFBPPR5192 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1236: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1237: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1238: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.1239: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1240: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1241: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.1242: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.1243: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.1244: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.1245: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1246: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1247: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1248: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.1249: DFBPPR5337 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial
Source.1250: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1251: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.1252: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1253: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1254: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1255: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.1256: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1257: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1258: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1259: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.1260: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.1261: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1262: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1263: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1264: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.1265: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.1266: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.1267: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.1268: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1269: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.1270: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1271: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.1272: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.1273: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.1274: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.1275: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.1276: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.1277: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1278: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.1279: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1280: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1281: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1282: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.1283: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1284: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1285: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.1286: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1287: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.1288: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.1289: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.1290: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.1291: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.1292: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.1293: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1294: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1295: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein
Source.1296: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.1297: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.1298: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.1299: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1300: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1301: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.1302: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1303: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.1304: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1305: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1306: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1307: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1308: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.1309: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1310: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1311: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1312: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.1313: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1314: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.1315: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.1316: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1317: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.1318: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1319: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.1320: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1321: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.1322: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1323: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1324: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1325: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.1326: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1327: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1328: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.1329: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1330: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1331: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.1332: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.1333: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1334: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1335: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.1336: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.1337: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1338: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1339: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.1340: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1341: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1342: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1343: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.1344: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.1345: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.1346: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.1347: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.1348: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.1349: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1350: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1351: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1352: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.1353: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1354: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.1355: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.1356: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1357: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.1358: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1359: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.1360: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.1361: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.1362: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1363: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2
Source.1364: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.1365: DFBPPR5830 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1366: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.1367: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1368: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1369: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1370: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.1371: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1372: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1373: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.1374: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1375: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.1376: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1377: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1378: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1379: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.1380: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.1381: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1382: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1383: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.1384: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.1385: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.1386: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1387: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.1388: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.1389: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5
Source.1390: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.1391: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.1392: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.1393: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.1394: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38
Source.1395: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.1396: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.1397: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3
Source.1398: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.1399: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.1400: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1
Source.1401: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1402: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1403: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1404: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.1405: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.1406: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1407: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.1408: DFBPPR6065 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1409: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1410: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.1411: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.1412: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1413: DFBPPR6139 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 3
Source.1414: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.1415: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17
Source.1416: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.1417: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid
Source.1418: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.1419: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.1420: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1421: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.1422: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1423: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.1424: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1425: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.1426: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1427: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.1428: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.1429: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.1430: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.1431: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.1432: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1433: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.1434: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1435: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.1436: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1437: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.1438: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1439: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.1440: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1441: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.1442: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.1443: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.1444: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.1445: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.1446: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.1447: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.1448: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1449: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.1450: DFBPPR6355 ---- Plant proteins ---- Endochitinase
Source.1451: DFBPPR6358 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1452: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.1453: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6
Source.1454: DFBPPR6421 ---- Plant proteins ---- 50S ribosomal protein L24, chloroplastic
Source.1455: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.1456: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.1457: DFBPPR6458 ---- Plant proteins ---- Convicilin
Source.1458: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.1459: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.1460: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein
Source.1461: DFBPPR6481 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1462: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.1463: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1464: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5
Source.1465: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.1466: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1467: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.1468: DFBPPR6520 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1469: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1470: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.1471: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27
Source.1472: DFBPPR6619 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1473: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1474: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1475: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1476: DFBPPR6639 ---- Plant proteins ---- Puroindoline-A
Source.1477: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.1478: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.1479: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.1480: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.1481: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.1482: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1483: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.1484: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.1485: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.1486: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1487: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1488: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1489: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1490: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.1491: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.1492: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1493: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1494: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.1495: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.1496: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.1497: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.1498: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.1499: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.1500: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1501: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.1502: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1503: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.1504: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.1505: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.1506: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.1507: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1508: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.1509: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1510: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1511: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7
Source.1512: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.1513: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.1514: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.1515: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1516: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1517: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1518: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.1519: DFBPPR6819 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1520: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1521: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1522: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1523: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.1524: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.1525: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1526: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1527: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1528: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial
Source.1529: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1530: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1531: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1532: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.1533: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.1534: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.1535: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.1536: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.1537: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.1538: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.1539: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1540: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1541: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1542: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1543: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.1544: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.1545: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1546: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.1547: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1548: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1549: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.1550: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1551: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1552: DFBPPR7047 ---- Plant proteins ---- Hordoindoline-A
Source.1553: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II
Source.1554: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.1555: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1556: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1557: DFBPPR7063 ---- Plant proteins ---- Glycine-rich RNA-binding protein blt801
Source.1558: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1559: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I
Source.1560: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1561: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1562: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1563: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.1564: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1565: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1566: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.1567: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1568: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.1569: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1570: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.1571: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1572: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1573: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1574: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1575: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1576: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.1577: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.1578: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1579: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1580: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1581: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.1582: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.1583: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.1584: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.1585: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1586: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.1587: DFBPPR7281 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1588: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1
Source.1589: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.1590: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1591: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1592: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1593: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R
Source.1594: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1
Source.1595: DFBPPR7345 ---- Plant proteins ---- Cold-regulated protein BLT14
Source.1596: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2
Source.1597: DFBPPR7354 ---- Plant proteins ---- Cold-regulated protein 1
Source.1598: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1599: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.1600: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.1601: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.1602: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase
Source.1603: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1604: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1605: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1606: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.1607: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.1608: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.1609: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.1610: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.1611: DFBPPR7494 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.1612: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1613: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1614: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.1615: DFBPPR7502 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1616: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.1617: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1618: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1619: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.1620: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.1621: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2
Source.1622: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1623: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.1624: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.1625: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1626: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.1627: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.1628: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1629: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein
Source.1630: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1631: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.1632: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.1633: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.1634: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1635: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.1636: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12
Source.1637: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.1638: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.1639: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2
Source.1640: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.1641: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.1642: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.1643: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.1644: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.1645: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1646: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1647: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1648: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1649: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.1650: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.1651: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.1652: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.1653: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1654: DFBPPR8362 ---- Plant proteins ---- Trypsin inhibitor 2c
Source.1655: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.1656: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.1657: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.1658: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1659: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1660: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.1661: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.1662: DFBPPR8403 ---- Plant proteins ---- Endochitinase 3
Source.1663: DFBPPR8404 ---- Plant proteins ---- Endochitinase 1A
Source.1664: DFBPPR8405 ---- Plant proteins ---- Endochitinase 1B
Source.1665: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.1666: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1667: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1668: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.1669: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.1670: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1671: DFBPPR8468 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1672: DFBPPR8485 ---- Milk proteins ---- Folate receptor alpha
Source.1673: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.1674: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.1675: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.1676: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.1677: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1678: DFBPPR8512 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.1679: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1680: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1681: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.1682: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.1683: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.1684: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.1685: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.1686: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.1687: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1688: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1689: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1690: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1691: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1692: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1693: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1694: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.1695: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.1696: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase
Source.1697: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1698: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.1699: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1700: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.1701: DFBPPR15998 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.1702: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1703: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.1704: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.1705: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1706: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1707: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.1708: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1709: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1710: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1711: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.1712: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1713: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1714: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1715: DFBPPR16044 ---- Animal proteins ---- High mobility group protein B1
Source.1716: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1717: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1718: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.1719: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.1720: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.1721: DFBPPR16067 ---- Animal proteins ---- CD40 ligand
Source.1722: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1723: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.1724: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.1725: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.1726: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.1727: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1728: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.1729: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.1730: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.1731: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1732: DFBPPR16103 ---- Animal proteins ---- Laforin
Source.1733: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1734: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1735: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.1736: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.1737: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1738: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1739: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.1740: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1741: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.1742: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.1743: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1744: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.1745: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.1746: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.1747: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.1748: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1749: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1750: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1751: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2
Source.1752: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1753: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1754: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.1755: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.1756: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.1757: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.1758: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.1759: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.1760: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.1761: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1762: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1763: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.1764: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1765: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1766: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.1767: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1768: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.1769: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1770: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.1771: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.1772: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1773: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.1774: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.1775: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1776: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.1777: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1778: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.1779: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1780: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.1781: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1782: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.1783: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1784: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1785: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1786: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1787: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.1788: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.1789: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1790: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1
Source.1791: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.1792: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.1793: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.1794: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1795: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25
Source.1796: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.1797: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1798: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.1799: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1800: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.1801: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.1802: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.1803: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.1804: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.1805: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1806: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.1807: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1808: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.1809: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.1810: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.1811: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.1812: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1813: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1814: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.1815: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.1816: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.1817: DFBPPR16497 ---- Animal proteins ---- Interleukin-5
Source.1818: DFBPPR16502 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.1819: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.1820: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.1821: DFBPPR16508 ---- Animal proteins ---- Protein crumbs homolog 3
Source.1822: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.1823: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.1824: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.1825: DFBPPR16537 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.1826: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1827: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.1828: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.1829: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.1830: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1831: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1832: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1833: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1834: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3
Source.1835: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.1836: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.1837: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.1838: DFBPPR16593 ---- Animal proteins ---- Calcyphosin
Source.1839: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.1840: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.1841: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain
Source.1842: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.1843: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.1844: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.1845: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.1846: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4
Source.1847: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.1848: DFBPPR16703 ---- Animal proteins ---- Beta-defensin 119
Source.1849: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.1850: DFBPPR16718 ---- Animal proteins ---- Zinc finger protein 331
Source.1851: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.1852: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.1853: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.1854: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.1855: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.1856: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.1857: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.1858: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1859: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.1860: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1861: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.1862: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109
Source.1863: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1864: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.1865: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.1866: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor
Source.1867: DFBPPR16865 ---- Animal proteins ---- Apolipoprotein E
Source.1868: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.1869: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.1870: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1871: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1872: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.1873: DFBPPR16905 ---- Animal proteins ---- Fatty acid-binding protein 5
Source.1874: DFBPPR16906 ---- Animal proteins ---- High mobility group protein B1
Source.1875: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.1876: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.1877: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.1878: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.1879: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.1880: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.1881: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.1882: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1883: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.1884: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1885: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.1886: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13
Source.1887: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.1888: DFBPPR16937 ---- Animal proteins ---- GTP:AMP phosphotransferase AK3, mitochondrial
Source.1889: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.1890: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1891: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.1892: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.1893: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.1894: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.1895: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.1896: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.1897: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.1898: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.1899: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.1900: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.1901: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.1902: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.1903: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.1904: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1905: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.1906: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.1907: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.1908: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.1909: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.1910: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.1911: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.1912: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.1913: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1914: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.1915: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.1916: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.1917: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1918: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1919: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.1920: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.1921: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.1922: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.1923: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.1924: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.1925: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1926: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.1927: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.1928: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.1929: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.1930: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.1931: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.1932: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.1933: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short
Source.1934: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1935: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.1936: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.1937: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.1938: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1939: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.1940: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1941: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6
Source.1942: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.1943: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1944: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.1945: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.1946: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.1947: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.1948: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1949: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1950: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1951: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1952: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.1953: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.1954: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.1955: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.1956: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.1957: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.1958: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.1959: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.1960: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.1961: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.1962: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.1963: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.1964: DFBPPR17324 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1965: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.1966: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1967: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.1968: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.1969: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1970: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.1971: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.1972: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.1973: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.1974: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.1975: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.1976: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1977: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.1978: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.1979: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.1980: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.1981: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1982: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.1983: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.1984: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.1985: DFBPPR17402 ---- Animal proteins ---- High mobility group protein B2
Source.1986: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.1987: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.1988: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.1989: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1990: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.1991: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1992: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.1993: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1994: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1
Source.1995: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.1996: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.1997: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.1998: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.1999: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.2000: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.2001: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2002: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.2003: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.2004: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.2005: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.2006: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1
Source.2007: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.2008: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.2009: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.2010: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.2011: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.2012: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.2013: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.2014: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.2015: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2016: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2017: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.2018: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.2019: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.2020: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.2021: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.2022: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.2023: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2024: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2025: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.2026: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.2027: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2028: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.2029: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.2030: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.2031: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.2032: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.2033: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.2034: DFBPPR17583 ---- Animal proteins ---- Cathelicidin-1
Source.2035: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.2036: DFBPPR17594 ---- Animal proteins ---- E-selectin
Source.2037: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7
Source.2038: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2039: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.2040: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.2041: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.2042: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.2043: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2044: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.2045: DFBPPR17663 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 4, mitochondrial
Source.2046: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta
Source.2047: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.2048: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.2049: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.2050: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.2051: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.2052: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.2053: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.2054: DFBPPR17727 ---- Animal proteins ---- Insulin-like 3
Source.2055: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.2056: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.2057: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.2058: DFBPPR17758 ---- Animal proteins ---- Matrix Gla protein
Source.2059: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.2060: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.2061: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.2062: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.2063: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.2064: DFBPPR17786 ---- Animal proteins ---- Cathelicidin-4
Source.2065: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.2066: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.2067: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.2068: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.2069: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.2070: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1
Source.2071: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.2072: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.2073: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.2074: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.2075: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.2076: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2077: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.2078: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.2079: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.2080: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.2081: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.2082: DFBPPR17855 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.2083: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.2084: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.2085: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.2086: DFBPPR17871 ---- Animal proteins ---- Ras-related protein Rab-11B
Source.2087: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.2088: DFBPPR17874 ---- Animal proteins ---- Endonuclease 8-like 2
Source.2089: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.2090: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.2091: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.2092: DFBPPR17884 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.2093: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.2094: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.2095: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2096: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.2097: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2098: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.2099: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.2100: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.2101: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.2102: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.2103: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.2104: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.2105: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2106: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.2107: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.2108: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.2109: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.2110: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.2111: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.2112: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.2113: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.2114: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.2115: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.2116: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.2117: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.2118: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.2119: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.2120: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.2121: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2122: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.2123: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.2124: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.2125: DFBPPR18033 ---- Animal proteins ---- Cathelicidin-3
Source.2126: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.2127: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.2128: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.2129: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.2130: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.2131: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.2132: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.2133: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.2134: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2135: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.2136: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase
Source.2137: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.2138: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.2139: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.2140: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.2141: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.2142: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2143: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2144: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.2145: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2146: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.2147: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.2148: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.2149: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.2150: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.2151: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.2152: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.2153: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.2154: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.2155: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.2156: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.2157: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.2158: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.2159: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.2160: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2161: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.2162: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.2163: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.2164: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.2165: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.2166: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.2167: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.2168: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.2169: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.2170: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.2171: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3
Source.2172: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.2173: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6
Source.2174: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.2175: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.2176: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta
Source.2177: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2178: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.2179: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.2180: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.2181: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.2182: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.2183: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.2184: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.2185: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.2186: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.2187: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.2188: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.2189: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.2190: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2191: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.2192: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.2193: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.2194: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.2195: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2196: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2197: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.2198: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2199: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3
Source.2200: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.2201: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.2202: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.2203: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.2204: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.2205: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.2206: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.2207: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.2208: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.2209: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.2210: DFBPPR18416 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.2211: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2212: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.2213: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.2214: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.2215: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2216: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.2217: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.2218: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.2219: DFBPPR18433 ---- Animal proteins ---- Basigin
Source.2220: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.2221: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12
Source.2222: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.2223: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2224: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.2225: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.2226: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.2227: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.2228: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.2229: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.2230: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.2231: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.2232: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.2233: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.2234: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.2235: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.2236: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.2237: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.2238: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.2239: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.2240: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.2241: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.2242: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.2243: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.2244: DFBPPR18524 ---- Animal proteins ---- Beta-defensin 5
Source.2245: DFBPPR18526 ---- Animal proteins ---- Beta-defensin 4
Source.2246: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.2247: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.2248: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.2249: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.2250: DFBPPR18552 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 8
Source.2251: DFBPPR18558 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.2252: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.2253: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.2254: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.2255: DFBPPR18581 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 7
Source.2256: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.2257: DFBPPR18600 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.2258: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4
Source.2259: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.2260: DFBPPR18609 ---- Animal proteins ---- ERO1-like protein alpha
Source.2261: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.2262: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2263: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.2264: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase
Source.2265: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.2266: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.2267: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.2268: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.2269: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.2270: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.2271: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.2272: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.2273: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.2274: DFBPPR18718 ---- Animal proteins ---- Chondroadherin
Source.2275: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.2276: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.2277: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2
Source.2278: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.2279: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.2280: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.2281: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.2282: DFBPPR18756 ---- Animal proteins ---- Eukaryotic translation initiation factor 4E
Source.2283: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.2284: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.2285: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.2286: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.2287: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.2288: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.2289: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein
Source.2290: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.2291: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.2292: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1
Source.2293: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.2294: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2
Source.2295: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.2296: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.2297: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.2298: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.2299: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.2300: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.2301: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.2302: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.2303: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.2304: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.2305: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.2306: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.2307: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.2308: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.2309: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.2310: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.2311: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.2312: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.2313: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.2314: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.2315: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.2316: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.2317: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.2318: DFBPPR18927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 5
Source.2319: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2320: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.2321: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.2322: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.2323: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.2324: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.2325: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.2326: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.2327: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.2328: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.2329: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.2330: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.2331: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.2332: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.2333: DFBPPR18980 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.2334: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.2335: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.2336: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.2337: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1
Source.2338: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.2339: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.2340: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.2341: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.2342: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.2343: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.2344: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.2345: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.2346: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.2347: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.2348: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.2349: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial
Source.2350: DFBPPR19059 ---- Animal proteins ---- Lysozyme C, non-stomach isozyme
Source.2351: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.2352: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.2353: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.2354: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2355: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.2356: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.2357: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.2358: DFBPPR19076 ---- Animal proteins ---- Protein MGARP
Source.2359: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.2360: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.2361: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.2362: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.2363: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.2364: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.2365: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.2366: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.2367: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.2368: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.2369: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.2370: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.2371: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.2372: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.2373: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2374: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.2375: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.2376: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.2377: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.2378: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2379: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.2380: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.2381: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.2382: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2
Source.2383: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.2384: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.2385: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.2386: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.2387: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2388: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.2389: DFBPPR19225 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.2390: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.2391: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.2392: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.2393: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.2394: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.2395: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.2396: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.2397: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.2398: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2399: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.2400: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.2401: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.2402: DFBPPR19273 ---- Animal proteins ---- Protein BEX3
Source.2403: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.2404: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.2405: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.2406: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.2407: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.2408: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3
Source.2409: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.2410: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.2411: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.2412: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.2413: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.2414: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3
Source.2415: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.2416: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1
Source.2417: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.2418: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.2419: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.2420: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.2421: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.2422: DFBPPR19331 ---- Animal proteins ---- Cathelicidin-6
Source.2423: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.2424: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.2425: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2426: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.2427: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.2428: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.2429: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3
Source.2430: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.2431: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.2432: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.2433: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.2434: DFBPPR19385 ---- Animal proteins ---- Cathelicidin-5
Source.2435: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.2436: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.2437: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.2438: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.2439: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.2440: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.2441: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.2442: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.2443: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.2444: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.2445: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.2446: DFBPPR19439 ---- Animal proteins ---- Adenylate kinase isoenzyme 6
Source.2447: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.2448: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.2449: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2450: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.2451: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.2452: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.2453: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.2454: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.2455: DFBPPR19463 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.2456: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.2457: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.2458: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.2459: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2460: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.2461: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.2462: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2463: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.2464: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.2465: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.2466: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.2467: DFBPPR19521 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12
Source.2468: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.2469: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.2470: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.2471: DFBPPR19540 ---- Animal proteins ---- Beta-defensin 6
Source.2472: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2473: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.2474: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.2475: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.2476: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.2477: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.2478: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.2479: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.2480: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.2481: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2482: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.2483: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.2484: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.2485: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.2486: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.2487: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.2488: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.2489: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.2490: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.2491: DFBPPR19602 ---- Animal proteins ---- Dynactin subunit 3
Source.2492: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.2493: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2494: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2495: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.2496: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.2497: DFBPPR19640 ---- Animal proteins ---- Prolargin
Source.2498: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.2499: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.2500: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.2501: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial
Source.2502: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.2503: DFBPPR19662 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1
Source.2504: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.2505: DFBPPR19665 ---- Animal proteins ---- Thioredoxin, mitochondrial
Source.2506: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.2507: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.2508: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.2509: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.2510: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.2511: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.2512: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2513: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.2514: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.2515: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.2516: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.2517: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3
Source.2518: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.2519: DFBPPR19760 ---- Animal proteins ---- Protein phosphatase 1K, mitochondrial
Source.2520: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.2521: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.2522: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2523: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.2524: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein
Source.2525: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11
Source.2526: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.2527: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.2528: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.2529: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.2530: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.2531: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2532: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.2533: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.2534: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.2535: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.2536: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.2537: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.2538: DFBPPR19844 ---- Animal proteins ---- Prosalusin
Source.2539: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.2540: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.2541: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.2542: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC
Source.2543: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.2544: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.2545: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.2546: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.2547: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.2548: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.2549: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.2550: DFBPPR19893 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.2551: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.2552: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.2553: DFBPPR19898 ---- Animal proteins ---- Essential MCU regulator, mitochondrial
Source.2554: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.2555: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.2556: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.2557: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.2558: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2559: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.2560: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.2561: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.2562: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial
Source.2563: DFBPPR19937 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.2564: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.2565: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.2566: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2567: DFBPPR19962 ---- Animal proteins ---- Troponin T, slow skeletal muscle
Source.2568: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.2569: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.2570: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2571: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.2572: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.2573: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein
Source.2574: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.2575: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.2576: DFBPPR20006 ---- Animal proteins ---- Protein Abitram
Source.2577: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2578: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1
Source.2579: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.2580: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.2581: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.2582: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.2583: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.2584: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.2585: DFBPPR20051 ---- Animal proteins ---- 28S ribosomal protein S18a, mitochondrial
Source.2586: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.2587: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.2588: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.2589: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.2590: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.2591: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.2592: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.2593: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.2594: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.2595: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.2596: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.2597: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.2598: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.2599: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2600: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.2601: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4
Source.2602: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.2603: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.2604: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.2605: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.2606: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.2607: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.2608: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.2609: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.2610: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2
Source.2611: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.2612: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.2613: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.2614: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.2615: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2616: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog
Source.2617: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.2618: DFBPPR20269 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor
Source.2619: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.2620: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.2621: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4
Source.2622: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.2623: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.2624: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.2625: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like
Source.2626: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal
Source.2627: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.2628: DFBPPR20304 ---- Animal proteins ---- Nuclear envelope phosphatase-regulatory subunit 1
Source.2629: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3
Source.2630: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV
Source.2631: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.2632: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.2633: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.2634: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.2635: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.2636: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.2637: DFBPPR20358 ---- Animal proteins ---- 39S ribosomal protein L34, mitochondrial
Source.2638: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.2639: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.2640: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.2641: DFBPPR20365 ---- Animal proteins ---- Interleukin-21
Source.2642: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1
Source.2643: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.2644: DFBPPR20383 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 7, mitochondrial
Source.2645: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.2646: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.2647: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2648: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial
Source.2649: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.2650: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.2651: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.2652: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.2653: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.2654: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.2655: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.2656: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.2657: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.2658: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.2659: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.2660: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog
Source.2661: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.2662: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4
Source.2663: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.2664: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.2665: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2
Source.2666: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.2667: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.2668: DFBPPR20540 ---- Animal proteins ---- Structure-specific endonuclease subunit SLX1
Source.2669: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.2670: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.2671: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.2672: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.2673: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog
Source.2674: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.2675: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.2676: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74
Source.2677: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.2678: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.2679: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.2680: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.2681: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.2682: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.2683: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.2684: DFBPPR20635 ---- Animal proteins ---- Transcription elongation factor A protein 1
Source.2685: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2686: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2687: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.2688: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.2689: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2
Source.2690: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.2691: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.2692: DFBPPR20671 ---- Animal proteins ---- 39S ribosomal protein L27, mitochondrial
Source.2693: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.2694: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.2695: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.2696: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial
Source.2697: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.2698: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.2699: DFBPPR20704 ---- Animal proteins ---- C-X-C motif chemokine 17
Source.2700: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.2701: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.2702: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial
Source.2703: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.2704: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase
Source.2705: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.2706: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.2707: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.2708: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.2709: DFBPPR20728 ---- Animal proteins ---- Serine protease 45
Source.2710: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.2711: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.2712: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.2713: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.2714: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.2715: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2716: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.2717: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.2718: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.2719: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.2720: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.2721: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.2722: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.2723: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.2724: DFBPPR20838 ---- Animal proteins ---- Cytochrome c oxidase subunit 6B2
Source.2725: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.2726: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.2727: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.2728: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.2729: DFBPPR20860 ---- Animal proteins ---- Vesicle-associated membrane protein 5
Source.2730: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5
Source.2731: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.2732: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.2733: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.2734: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.2735: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.2736: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2737: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.2738: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.2739: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12
Source.2740: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.2741: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.2742: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.2743: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A
Source.2744: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.2745: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.2746: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9
Source.2747: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.2748: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.2749: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial
Source.2750: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.2751: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.2752: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.2753: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.2754: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.2755: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.2756: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181
Source.2757: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.2758: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.2759: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.2760: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.2761: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1
Source.2762: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.2763: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.2764: DFBPPR21038 ---- Animal proteins ---- Sodium channel modifier 1
Source.2765: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2766: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.2767: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B
Source.2768: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.2769: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.2770: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial
Source.2771: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.2772: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.2773: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.2774: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.2775: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.2776: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.2777: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.2778: DFBPPR21133 ---- Animal proteins ---- Polycomb group RING finger protein 3
Source.2779: DFBPPR21139 ---- Animal proteins ---- Transcription elongation factor A protein 3
Source.2780: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2781: DFBPPR21143 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog
Source.2782: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.2783: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.2784: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.2785: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52
Source.2786: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2787: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.2788: DFBPPR21206 ---- Animal proteins ---- D-dopachrome decarboxylase
Source.2789: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.2790: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.2791: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.2792: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.2793: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.2794: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.2795: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.2796: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.2797: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2798: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1
Source.2799: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.2800: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.2801: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.2802: DFBPPR21250 ---- Animal proteins ---- Enteric beta-defensin
Source.2803: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.2804: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21
Source.2805: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2806: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.2807: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.2808: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.2809: DFBPPR21286 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM7 homolog
Source.2810: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.2811: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.2812: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial
Source.2813: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.2814: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.2815: DFBPPR21318 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.2816: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.2817: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.2818: DFBPPR21343 ---- Animal proteins ---- DNA polymerase delta subunit 4
Source.2819: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.2820: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.2821: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.2822: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.2823: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.2824: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.2825: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.2826: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.2827: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.2828: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.2829: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.2830: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.2831: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.2832: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.2833: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.2834: DFBPPR21428 ---- Animal proteins ---- Protein LBH
Source.2835: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.2836: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.2837: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.2838: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.2839: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.2840: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A
Source.2841: DFBPPR21463 ---- Animal proteins ---- Protein BEX2
Source.2842: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.2843: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.2844: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.2845: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.2846: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.2847: DFBPPR21477 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 35
Source.2848: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.2849: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.2850: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.2851: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.2852: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.2853: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.2854: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.2855: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.2856: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.2857: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.2858: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.2859: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.2860: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.2861: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.2862: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.2863: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.2864: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23
Source.2865: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2866: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.2867: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2868: DFBPPR21603 ---- Animal proteins ---- Beta-defensin 119
Source.2869: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138
Source.2870: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.2871: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.2872: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.2873: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.2874: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.2875: DFBPPR21644 ---- Animal proteins ---- Mpv17-like protein 2
Source.2876: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.2877: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.2878: DFBPPR21652 ---- Animal proteins ---- Protein Flattop
Source.2879: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.2880: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.2881: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.2882: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.2883: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.2884: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.2885: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.2886: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4
Source.2887: DFBPPR21676 ---- Animal proteins ---- ER membrane protein complex subunit 6
Source.2888: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.2889: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.2890: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.2891: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.2892: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.2893: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.2894: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.2895: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.2896: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.2897: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.2898: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.2899: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.2900: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6
Source.2901: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.2902: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12
Source.2903: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.2904: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.2905: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.2906: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.2907: DFBPPR21785 ---- Animal proteins ---- Spermatogenesis-associated protein 19, mitochondrial
Source.2908: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2
Source.2909: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.2910: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.2911: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial
Source.2912: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.2913: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.2914: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.2915: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2916: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.2917: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.2918: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.2919: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.2920: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.2921: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.2922: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.2923: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.2924: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.2925: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC
Source.2926: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.2927: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.2928: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.2929: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.2930: DFBPPR21880 ---- Animal proteins ---- Zinc finger protein 22
Source.2931: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1
Source.2932: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.2933: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial
Source.2934: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein
Source.2935: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5
Source.2936: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1
Source.2937: DFBPPR21901 ---- Animal proteins ---- Calcyphosin
Source.2938: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.2939: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.2940: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.2941: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.2942: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.2943: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14
Source.2944: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.2945: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.2946: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.2947: DFBPPR21938 ---- Animal proteins ---- Protein RER1
Source.2948: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.2949: DFBPPR21941 ---- Animal proteins ---- MOB kinase activator 3A
Source.2950: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.2951: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.2952: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.2953: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.2954: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.2955: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.2956: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.2957: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.2958: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.2959: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.2960: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10
Source.2961: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.2962: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.2963: DFBPPR22007 ---- Animal proteins ---- Protein C8orf37 homolog
Source.2964: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.2965: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.2966: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.2967: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.2968: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.2969: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.2970: DFBPPR22029 ---- Animal proteins ---- COMM domain-containing protein 7
Source.2971: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.2972: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.2973: DFBPPR22035 ---- Animal proteins ---- Protein CCSMST1
Source.2974: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.2975: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2976: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog
Source.2977: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.2978: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.2979: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B
Source.2980: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4
Source.2981: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.2982: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B
Source.2983: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.2984: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.2985: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.2986: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4
Source.2987: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.2988: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.2989: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11
Source.2990: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.2991: DFBPPR22133 ---- Animal proteins ---- MOB kinase activator 3C
Source.2992: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.2993: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B
Source.2994: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.2995: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2
Source.2996: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.2997: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.2998: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.2999: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.3000: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.3001: DFBPPR22190 ---- Animal proteins ---- Protein NKG7
Source.3002: DFBPPR22194 ---- Animal proteins ---- Cystatin-9
Source.3003: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.3004: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.3005: DFBPPR22221 ---- Animal proteins ---- Ubiquitin-like protein 5
Source.3006: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.3007: DFBPPR22231 ---- Animal proteins ---- DnaJ homolog subfamily C member 12
Source.3008: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.3009: DFBPPR22249 ---- Animal proteins ---- CXXC motif containing zinc binding protein
Source.3010: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1
Source.3011: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5
Source.3012: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.3013: DFBPPR22266 ---- Animal proteins ---- Vexin
Source.3014: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17
Source.3015: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B
Source.3016: DFBPPR22295 ---- Animal proteins ---- Protein PROCA1
Source.3017: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.3018: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.3019: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.3020: DFBPPR22323 ---- Animal proteins ---- Meiosis expressed gene 1 protein homolog
Source.3021: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.3022: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.3023: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.3024: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.3025: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.3026: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.3027: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.3028: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.3029: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.3030: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.3031: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2
Source.3032: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.3033: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.3034: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.3035: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.3036: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.3037: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1
Source.3038: DFBPPR22402 ---- Animal proteins ---- Alternative prion protein
Source.3039: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.3040: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.3041: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B
Source.3042: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.3043: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.3044: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.3045: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.3046: DFBPPR22461 ---- Animal proteins ---- Ashwin
Source.3047: DFBPPR22467 ---- Animal proteins ---- Coiled-coil domain-containing protein 42
Source.3048: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.3049: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.3050: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.3051: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C
Source.3052: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.3053: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1
Source.3054: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.3055: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog
Source.3056: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.3057: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.3058: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C
Source.3059: DFBPPR22514 ---- Animal proteins ---- Transmembrane protein 205
Source.3060: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.3061: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2
Source.3062: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.3063: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.3064: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.3065: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.3066: DFBPPR22546 ---- Animal proteins ---- ADP-ribosylation factor-like protein 15
Source.3067: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.3068: DFBPPR22562 ---- Animal proteins ---- Uncharacterized protein C2orf50 homolog
Source.3069: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.3070: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein
Source.3071: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.3072: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.3073: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.3074: DFBPPR22596 ---- Animal proteins ---- Ubiquitin domain-containing protein 2
Source.3075: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.3076: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.3077: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.3078: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.3079: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.3080: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4
Source.3081: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157
Source.3082: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.3083: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5
Source.3084: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.3085: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.3086: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog
Source.3087: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.3088: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.3089: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A
Source.3090: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.3091: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.3092: DFBPPR22696 ---- Animal proteins ---- Protein FAM228B
Source.3093: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.3094: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.3095: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1
Source.3096: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.3097: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.3098: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.3099: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.3100: DFBPPR22747 ---- Animal proteins ---- Uncharacterized protein C1orf100 homolog
Source.3101: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.3102: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog
Source.3103: DFBPPR22755 ---- Animal proteins ---- Uncharacterized protein C11orf86 homolog
Source.3104: DFBPPR22756 ---- Animal proteins ---- Uncharacterized protein C1orf189 homolog
Source.3105: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.3106: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.3107: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.3108: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3109: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3110: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.3111: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3112: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.3113: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.3114: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3115: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.3116: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.3117: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.3118: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.3119: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3120: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.3121: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.3122: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.3123: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.3124: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.3125: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3126: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.3127: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.3128: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.3129: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.3130: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.3131: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.3132: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.3133: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.3134: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.3135: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3136: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.3137: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.3138: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3139: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.3140: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.3141: DFBPPR8623 ---- Animal proteins ---- High mobility group protein B1
Source.3142: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.3143: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.3144: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.3145: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3146: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.3147: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.3148: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.3149: DFBPPR8667 ---- Animal proteins ---- High mobility group protein B2
Source.3150: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.3151: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.3152: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.3153: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.3154: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.3155: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.3156: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.3157: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.3158: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.3159: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.3160: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.3161: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.3162: DFBPPR8697 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.3163: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3164: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.3165: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.3166: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.3167: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.3168: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3169: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.3170: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.3171: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.3172: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.3173: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.3174: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.3175: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3176: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.3177: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3178: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.3179: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3180: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.3181: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.3182: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3183: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.3184: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3185: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.3186: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.3187: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.3188: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.3189: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S
Source.3190: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.3191: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3192: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.3193: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.3194: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.3195: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3196: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.3197: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.3198: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.3199: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3200: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.3201: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.3202: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.3203: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.3204: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.3205: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3206: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.3207: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.3208: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.3209: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3210: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.3211: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.3212: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.3213: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3214: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.3215: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha
Source.3216: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha
Source.3217: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.3218: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.3219: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.3220: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3221: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.3222: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.3223: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3224: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.3225: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.3226: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.3227: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.3228: DFBPPR9009 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.3229: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.3230: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.3231: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.3232: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.3233: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.3234: DFBPPR9037 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain
Source.3235: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.3236: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.3237: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.3238: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.3239: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.3240: DFBPPR9089 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3241: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.3242: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.3243: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3244: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.3245: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3246: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3247: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3248: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3249: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.3250: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.3251: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.3252: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3253: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.3254: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.3255: DFBPPR9149 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.3256: DFBPPR9150 ---- Animal proteins ---- Protegrin-1
Source.3257: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3258: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.3259: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.3260: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.3261: DFBPPR9173 ---- Animal proteins ---- Neurotrophin-3
Source.3262: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.3263: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3264: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase
Source.3265: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.3266: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.3267: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.3268: DFBPPR9239 ---- Animal proteins ---- Prophenin-2
Source.3269: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.3270: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.3271: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.3272: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.3273: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.3274: DFBPPR9256 ---- Animal proteins ---- Antibacterial protein PR-39
Source.3275: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.3276: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3277: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.3278: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.3279: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.3280: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.3281: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.3282: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3283: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.3284: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.3285: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.3286: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1
Source.3287: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.3288: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.3289: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.3290: DFBPPR9333 ---- Animal proteins ---- Protegrin-3
Source.3291: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3292: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.3293: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.3294: DFBPPR9345 ---- Animal proteins ---- Relaxin-3
Source.3295: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.3296: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3297: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3298: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.3299: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11
Source.3300: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.3301: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.3302: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.3303: DFBPPR9408 ---- Animal proteins ---- CD70 antigen
Source.3304: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3305: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3306: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3307: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.3308: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3309: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.3310: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.3311: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.3312: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3313: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3314: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.3315: DFBPPR9449 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.3316: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.3317: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.3318: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3319: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.3320: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.3321: DFBPPR9495 ---- Animal proteins ---- Complement factor B
Source.3322: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.3323: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.3324: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.3325: DFBPPR9518 ---- Animal proteins ---- Interleukin-5
Source.3326: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.3327: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.3328: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor
Source.3329: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.3330: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.3331: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.3332: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.3333: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.3334: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.3335: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.3336: DFBPPR9568 ---- Animal proteins ---- Antibacterial peptide PMAP-23
Source.3337: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.3338: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3339: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.3340: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.3341: DFBPPR9597 ---- Animal proteins ---- Insulin-like 3
Source.3342: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.3343: DFBPPR9608 ---- Animal proteins ---- Interleukin-21
Source.3344: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3345: DFBPPR9611 ---- Animal proteins ---- Protegrin-4
Source.3346: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.3347: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.3348: DFBPPR9629 ---- Animal proteins ---- Antibacterial peptide PMAP-36
Source.3349: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3350: DFBPPR9638 ---- Animal proteins ---- Troponin T, slow skeletal muscle
Source.3351: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein
Source.3352: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.3353: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3354: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.3355: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.3356: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3357: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.3358: DFBPPR9698 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.3359: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.3360: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.3361: DFBPPR9706 ---- Animal proteins ---- Homeobox protein Hox-B8
Source.3362: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.3363: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.3364: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.3365: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.3366: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.3367: DFBPPR9740 ---- Animal proteins ---- Neprilysin
Source.3368: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.3369: DFBPPR9747 ---- Animal proteins ---- Protegrin-5
Source.3370: DFBPPR9767 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.3371: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1
Source.3372: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A
Source.3373: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.3374: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3375: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.3376: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.3377: DFBPPR9793 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1
Source.3378: DFBPPR9802 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM7 homolog
Source.3379: DFBPPR9803 ---- Animal proteins ---- 60S ribosomal protein L3
Source.3380: DFBPPR9809 ---- Animal proteins ---- Antibacterial peptide PMAP-37
Source.3381: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.3382: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.3383: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.3384: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.3385: DFBPPR9837 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.3386: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1
Source.3387: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C
Source.3388: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.3389: DFBPPR9863 ---- Animal proteins ---- Spermatid nuclear transition protein 3
Source.3390: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3391: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.3392: DFBPPR9892 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog
Source.3393: DFBPPR9939 ---- Animal proteins ---- Tctex1 domain-containing protein 4
Source.3394: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.3395: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.3396: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.3397: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.3398: DFBPPR9965 ---- Animal proteins ---- Lysozyme C
Source.3399: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.3400: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.3401: DFBPPR9973 ---- Animal proteins ---- High mobility group protein B1
Source.3402: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.3403: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.3404: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.3405: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.3406: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.3407: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein
Source.3408: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.3409: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.3410: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.3411: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.3412: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.3413: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.3414: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.3415: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3416: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2
Source.3417: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3418: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides
Source.3419: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.3420: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.3421: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3422: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.3423: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2
Source.3424: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.3425: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.3426: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.3427: DFBPPR10052 ---- Animal proteins ---- Protein Wnt-11
Source.3428: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a
Source.3429: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.3430: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.3431: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.3432: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17
Source.3433: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.3434: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.3435: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.3436: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3437: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.3438: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3439: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.3440: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.3441: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.3442: DFBPPR10088 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.3443: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3444: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3445: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.3446: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.3447: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.3448: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.3449: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.3450: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.3451: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.3452: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.3453: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3454: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.3455: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.3456: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.3457: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.3458: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.3459: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3460: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.3461: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.3462: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.3463: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.3464: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.3465: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3
Source.3466: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.3467: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II
Source.3468: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.3469: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.3470: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.3471: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.3472: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.3473: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.3474: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.3475: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.3476: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.3477: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.3478: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.3479: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.3480: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.3481: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.3482: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.3483: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.3484: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.3485: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.3486: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.3487: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.3488: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.3489: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.3490: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.3491: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.3492: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.3493: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.3494: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.3495: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.3496: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.3497: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.3498: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.3499: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.3500: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.3501: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.3502: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.3503: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.3504: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.3505: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.3506: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.3507: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3508: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.3509: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.3510: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.3511: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.3512: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.3513: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3514: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.3515: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.3516: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.3517: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.3518: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.3519: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.3520: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.3521: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.3522: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.3523: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.3524: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.3525: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.3526: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.3527: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3528: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.3529: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.3530: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.3531: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.3532: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.3533: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.3534: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3535: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.3536: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.3537: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.3538: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.3539: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.3540: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.3541: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.3542: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3543: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.3544: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.3545: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.3546: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.3547: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.3548: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.3549: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3550: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3551: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.3552: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.3553: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.3554: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3555: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.3556: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.3557: DFBPPR10453 ---- Animal proteins ---- Neurotrophin-3
Source.3558: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.3559: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.3560: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.3561: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3562: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.3563: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.3564: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.3565: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.3566: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.3567: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.3568: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.3569: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.3570: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.3571: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.3572: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.3573: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3574: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.3575: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3
Source.3576: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.3577: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.3578: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.3579: DFBPPR10548 ---- Animal proteins ---- Syndecan-4
Source.3580: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.3581: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.3582: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.3583: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3584: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.3585: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3586: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.3587: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.3588: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.3589: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6
Source.3590: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.3591: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5
Source.3592: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.3593: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.3594: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.3595: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.3596: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.3597: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.3598: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.3599: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.3600: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.3601: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.3602: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.3603: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein
Source.3604: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.3605: DFBPPR10647 ---- Animal proteins ---- Gallinacin-4
Source.3606: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.3607: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.3608: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.3609: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3610: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3611: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.3612: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.3613: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.3614: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.3615: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.3616: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3617: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3618: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a
Source.3619: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3620: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.3621: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.3622: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.3623: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.3624: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.3625: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.3626: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.3627: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.3628: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.3629: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.3630: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.3631: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.3632: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.3633: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3634: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.3635: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.3636: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.3637: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.3638: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3639: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.3640: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3641: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3642: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3643: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.3644: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2
Source.3645: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.3646: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.3647: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.3648: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.3649: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.3650: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.3651: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1
Source.3652: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.3653: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.3654: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.3655: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.3656: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.3657: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.3658: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.3659: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.3660: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.3661: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.3662: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.3663: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.3664: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.3665: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.3666: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.3667: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.3668: DFBPPR10916 ---- Animal proteins ---- Gallinacin-5
Source.3669: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.3670: DFBPPR10920 ---- Animal proteins ---- Troponin T, fast skeletal muscle isoforms
Source.3671: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.3672: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.3673: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.3674: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.3675: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.3676: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.3677: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.3678: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.3679: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.3680: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.3681: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.3682: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.3683: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.3684: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.3685: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.3686: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.3687: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3688: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.3689: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.3690: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.3691: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.3692: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.3693: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.3694: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.3695: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1
Source.3696: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.3697: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.3698: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.3699: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.3700: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.3701: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.3702: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.3703: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.3704: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.3705: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.3706: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.3707: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.3708: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.3709: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.3710: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.3711: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2
Source.3712: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.3713: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.3714: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.3715: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.3716: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.3717: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.3718: DFBPPR11102 ---- Animal proteins ---- Interferon type A3
Source.3719: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.3720: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3721: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.3722: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.3723: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3724: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.3725: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.3726: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3727: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.3728: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.3729: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.3730: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.3731: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.3732: DFBPPR11174 ---- Animal proteins ---- Gallinacin-6
Source.3733: DFBPPR11177 ---- Animal proteins ---- Gallinacin-11
Source.3734: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.3735: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.3736: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.3737: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.3738: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3739: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.3740: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.3741: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.3742: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone
Source.3743: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.3744: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.3745: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.3746: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.3747: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.3748: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.3749: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.3750: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.3751: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3
Source.3752: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.3753: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.3754: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.3755: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.3756: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.3757: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.3758: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.3759: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES
Source.3760: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.3761: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.3762: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.3763: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3764: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.3765: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.3766: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.3767: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3
Source.3768: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.3769: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.3770: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.3771: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.3772: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.3773: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.3774: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.3775: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.3776: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.3777: DFBPPR11358 ---- Animal proteins ---- Lysozyme g
Source.3778: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.3779: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.3780: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.3781: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.3782: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.3783: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.3784: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.3785: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.3786: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.3787: DFBPPR11412 ---- Animal proteins ---- Hyaluronan synthase 3
Source.3788: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3789: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.3790: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.3791: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.3792: DFBPPR11427 ---- Animal proteins ---- Protein Abitram
Source.3793: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.3794: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3795: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.3796: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.3797: DFBPPR11444 ---- Animal proteins ---- Troponin T, cardiac muscle isoforms
Source.3798: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.3799: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.3800: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2
Source.3801: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.3802: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3
Source.3803: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.3804: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.3805: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.3806: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.3807: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.3808: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.3809: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.3810: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.3811: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.3812: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.3813: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.3814: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.3815: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.3816: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.3817: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.3818: DFBPPR11526 ---- Animal proteins ---- Fibromodulin
Source.3819: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.3820: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.3821: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.3822: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.3823: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.3824: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.3825: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC
Source.3826: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.3827: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.3828: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.3829: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.3830: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.3831: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.3832: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.3833: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.3834: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.3835: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.3836: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.3837: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.3838: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.3839: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.3840: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.3841: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3842: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3
Source.3843: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.3844: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3845: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.3846: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.3847: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.3848: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.3849: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.3850: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10
Source.3851: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.3852: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.3853: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.3854: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.3855: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.3856: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.3857: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.3858: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.3859: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain
Source.3860: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.3861: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.3862: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.3863: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.3864: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.3865: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.3866: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1
Source.3867: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.3868: DFBPPR11719 ---- Animal proteins ---- Protein RER1
Source.3869: DFBPPR11723 ---- Animal proteins ---- Visinin
Source.3870: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.3871: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.3872: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.3873: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.3874: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.3875: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.3876: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.3877: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.3878: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.3879: DFBPPR11758 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17B
Source.3880: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.3881: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.3882: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.3883: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.3884: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.3885: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.3886: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.3887: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.3888: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.3889: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.3890: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.3891: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.3892: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1
Source.3893: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.3894: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.3895: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.3896: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.3897: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.3898: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.3899: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.3900: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.3901: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.3902: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.3903: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.3904: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.3905: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.3906: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.3907: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.3908: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.3909: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.3910: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor
Source.3911: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.3912: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.3913: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.3914: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.3915: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.3916: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.3917: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1
Source.3918: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.3919: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.3920: DFBPPR12015 ---- Animal proteins ---- Homeobox protein Hox-D1
Source.3921: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.3922: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.3923: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.3924: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.3925: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.3926: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.3927: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.3928: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.3929: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.3930: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.3931: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.3932: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.3933: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.3934: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.3935: DFBPPR12097 ---- Animal proteins ---- Photoreceptor outer segment membrane glycoprotein 2
Source.3936: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.3937: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.3938: DFBPPR12112 ---- Animal proteins ---- Protein LBH
Source.3939: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.3940: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.3941: DFBPPR12121 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.3942: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.3943: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3944: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.3945: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.3946: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.3947: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.3948: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.3949: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.3950: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.3951: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.3952: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B
Source.3953: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.3954: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.3955: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.3956: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.3957: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.3958: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.3959: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.3960: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.3961: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.3962: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.3963: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.3964: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.3965: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7
Source.3966: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.3967: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.3968: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.3969: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.3970: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.3971: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.3972: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.3973: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3974: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3975: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.3976: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.3977: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3978: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.3979: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.3980: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.3981: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.3982: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.3983: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.3984: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.3985: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.3986: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.3987: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.3988: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3989: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.3990: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.3991: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.3992: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.3993: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.3994: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.3995: DFBPPR12336 ---- Animal proteins ---- Apolipoprotein D
Source.3996: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.3997: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.3998: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3999: DFBPPR12350 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.4000: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.4001: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.4002: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.4003: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.4004: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4005: DFBPPR12361 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.4006: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.4007: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.4008: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a
Source.4009: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.4010: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.4011: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.4012: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.4013: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.4014: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.4015: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.4016: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.4017: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.4018: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.4019: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.4020: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.4021: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.4022: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.4023: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.4024: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.4025: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.4026: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.4027: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.4028: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.4029: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.4030: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.4031: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.4032: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.4033: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.4034: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.4035: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4036: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.4037: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.4038: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.4039: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.4040: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.4041: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4042: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.4043: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4044: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.4045: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.4046: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.4047: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4048: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4049: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.4050: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.4051: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.4052: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.4053: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.4054: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.4055: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.4056: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.4057: DFBPPR12476 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.4058: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4059: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.4060: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.4061: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.4062: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4063: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.4064: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.4065: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.4066: DFBPPR12508 ---- Animal proteins ---- Interleukin-2
Source.4067: DFBPPR12514 ---- Animal proteins ---- Transmembrane protein 109
Source.4068: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.4069: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase
Source.4070: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.4071: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.4072: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.4073: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.4074: DFBPPR12538 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.4075: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.4076: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.4077: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.4078: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.4079: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4080: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.4081: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4082: DFBPPR12560 ---- Animal proteins ---- Calumenin
Source.4083: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4084: DFBPPR12566 ---- Animal proteins ---- Eukaryotic translation initiation factor 4E
Source.4085: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4086: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.4087: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.4088: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.4089: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.4090: DFBPPR12593 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.4091: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.4092: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.4093: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.4094: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.4095: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4096: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.4097: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.4098: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.4099: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4100: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.4101: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.4102: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.4103: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.4104: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4105: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.4106: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.4107: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin
Source.4108: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.4109: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.4110: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.4111: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.4112: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.4113: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4114: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4115: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.4116: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.4117: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.4118: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25
Source.4119: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.4120: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.4121: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.4122: DFBPPR12761 ---- Animal proteins ---- Trichohyalin
Source.4123: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.4124: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.4125: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.4126: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.4127: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.4128: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.4129: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.4130: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.4131: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4132: DFBPPR12827 ---- Animal proteins ---- Matrix Gla protein
Source.4133: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.4134: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase
Source.4135: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.4136: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.4137: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.4138: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.4139: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4140: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.4141: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.4142: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.4143: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.4144: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.4145: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.4146: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.4147: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.4148: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.4149: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.4150: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A
Source.4151: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.4152: DFBPPR12924 ---- Animal proteins ---- Adenylate kinase isoenzyme 6
Source.4153: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.4154: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.4155: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.4156: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.4157: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.4158: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.4159: DFBPPR12948 ---- Animal proteins ---- Apolipoprotein C-IV
Source.4160: DFBPPR12952 ---- Animal proteins ---- Serum amyloid A-1 protein
Source.4161: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.4162: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.4163: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.4164: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.4165: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.4166: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4167: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.4168: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.4169: DFBPPR13003 ---- Animal proteins ---- Calcyphosin
Source.4170: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4171: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.4172: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.4173: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.4174: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.4175: DFBPPR13030 ---- Animal proteins ---- T-cell surface glycoprotein CD1b
Source.4176: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S
Source.4177: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.4178: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.4179: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.4180: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.4181: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.4182: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.4183: DFBPPR13075 ---- Animal proteins ---- 60S ribosomal protein L5
Source.4184: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.4185: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.4186: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.4187: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4188: DFBPPR13121 ---- Animal proteins ---- Ig heavy chain V-A2 region P-MU-3
Source.4189: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.4190: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4191: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4192: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.4193: DFBPPR13169 ---- Animal proteins ---- High mobility group protein B1
Source.4194: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.4195: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4196: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.4197: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.4198: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.4199: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.4200: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.4201: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.4202: DFBPPR13213 ---- Animal proteins ---- Seminal plasma protein HSP-1
Source.4203: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.4204: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.4205: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.4206: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4207: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.4208: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.4209: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4210: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.4211: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.4212: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.4213: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4214: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4215: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.4216: DFBPPR13267 ---- Animal proteins ---- Interferon beta
Source.4217: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4218: DFBPPR13271 ---- Animal proteins ---- Alpha-defensin 1
Source.4219: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.4220: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.4221: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4222: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.4223: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.4224: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain
Source.4225: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.4226: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.4227: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.4228: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4229: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4230: DFBPPR13376 ---- Animal proteins ---- Interleukin-5
Source.4231: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4232: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4233: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4234: DFBPPR13414 ---- Animal proteins ---- Melanotropin beta
Source.4235: DFBPPR13415 ---- Animal proteins ---- Melanotropin alpha
Source.4236: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor
Source.4237: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.4238: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.4239: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4240: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4241: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4242: DFBPPR13463 ---- Animal proteins ---- Cathelicidin-2
Source.4243: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4244: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.4245: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.4246: DFBPPR13497 ---- Animal proteins ---- Plasminogen
Source.4247: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.4248: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4249: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.4250: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4251: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4252: DFBPPR13538 ---- Animal proteins ---- Apolipoprotein E
Source.4253: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4254: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.4255: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.4256: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor
Source.4257: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.4258: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.4259: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4260: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.4261: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4262: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.4263: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4264: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4265: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4266: DFBPPR13602 ---- Animal proteins ---- Acrosin
Source.4267: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4268: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.4269: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.4270: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.4271: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.4272: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.4273: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.4274: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4275: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.4276: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.4277: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4278: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.4279: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.4280: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.4281: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.4282: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.4283: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4284: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.4285: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.4286: DFBPPR13740 ---- Animal proteins ---- Lysozyme C, kidney isozyme
Source.4287: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.4288: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.4289: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4290: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4291: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4292: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.4293: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4294: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4295: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4296: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.4297: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.4298: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.4299: DFBPPR13789 ---- Animal proteins ---- Tryptase-2
Source.4300: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain
Source.4301: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.4302: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.4303: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.4304: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.4305: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.4306: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.4307: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.4308: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.4309: DFBPPR13851 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2A
Source.4310: DFBPPR13864 ---- Animal proteins ---- Interleukin-5
Source.4311: DFBPPR13870 ---- Animal proteins ---- Cathelicidin-3
Source.4312: DFBPPR13874 ---- Animal proteins ---- Cathelicidin-2
Source.4313: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.4314: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4315: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4316: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.4317: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4318: DFBPPR13911 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2C
Source.4319: DFBPPR13915 ---- Animal proteins ---- Gastrin-releasing peptide
Source.4320: DFBPPR13920 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.4321: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4322: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.4323: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4324: DFBPPR13949 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2B
Source.4325: DFBPPR13955 ---- Animal proteins ---- Beta-defensin 2
Source.4326: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.4327: DFBPPR13974 ---- Animal proteins ---- Alternative prion protein
Source.4328: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.4329: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.4330: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.4331: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.4332: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4333: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.4334: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.4335: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.4336: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.4337: DFBPPR14024 ---- Animal proteins ---- Gamma-crystallin S
Source.4338: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.4339: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.4340: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4341: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.4342: DFBPPR14083 ---- Marine protein ---- RING-box protein 1
Source.4343: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.4344: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.4345: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.4346: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.4347: DFBPPR14133 ---- Marine protein ---- Calumenin-B
Source.4348: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.4349: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.4350: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.4351: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.4352: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.4353: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E
Source.4354: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.4355: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.4356: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.4357: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase
Source.4358: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.4359: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.4360: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.4361: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin
Source.4362: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.4363: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a
Source.4364: DFBPPR14277 ---- Marine protein ---- Cytochrome c oxidase subunit 5A-2, mitochondrial
Source.4365: DFBPPR14280 ---- Marine protein ---- Cytochrome c oxidase subunit 5A-1, mitochondrial
Source.4366: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.4367: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.4368: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4369: DFBPPR14321 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.4370: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.4371: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.4372: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4373: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.4374: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.4375: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.4376: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta
Source.4377: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.4378: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.4379: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic
Source.4380: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.4381: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.4382: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic
Source.4383: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4384: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1
Source.4385: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.4386: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35
Source.4387: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.4388: DFBPPR14546 ---- Marine protein ---- Stanniocalcin
Source.4389: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B
Source.4390: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.4391: DFBPPR14562 ---- Marine protein ---- Ladderlectin
Source.4392: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.4393: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4394: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.4395: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.4396: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.4397: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4398: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein
Source.4399: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.4400: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.4401: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.4402: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.4403: DFBPPR14625 ---- Marine protein ---- Somatostatin-2
Source.4404: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.4405: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A
Source.4406: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B
Source.4407: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.4408: DFBPPR14666 ---- Marine protein ---- High mobility group-T protein
Source.4409: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.4410: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.4411: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.4412: DFBPPR14701 ---- Marine protein ---- Hepcidin
Source.4413: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.4414: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.4415: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.4416: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.4417: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.4418: DFBPPR14766 ---- Marine protein ---- Tachyplesin-2
Source.4419: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.4420: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.4421: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.4422: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.4423: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.4424: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.4425: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.4426: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.4427: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.4428: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.4429: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.4430: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.4431: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.4432: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.4433: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2
Source.4434: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.4435: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.4436: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.4437: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.4438: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.4439: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.4440: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.4441: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.4442: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.4443: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.4444: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.4445: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3
Source.4446: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.4447: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.4448: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.4449: DFBPPR14919 ---- Microorganism protein ---- Transcription elongation factor SPT4
Source.4450: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.4451: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.4452: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.4453: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.4454: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.4455: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.4456: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.4457: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.4458: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.4459: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.4460: DFBPPR14999 ---- Microorganism protein ---- Histone H3-like centromeric protein CSE4
Source.4461: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.4462: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1
Source.4463: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.4464: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.4465: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.4466: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.4467: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.4468: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.4469: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.4470: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13
Source.4471: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.4472: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.4473: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.4474: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.4475: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.4476: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial
Source.4477: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.4478: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.4479: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.4480: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase
Source.4481: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.4482: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.4483: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.4484: DFBPPR15124 ---- Microorganism protein ---- Autophagy protein 16
Source.4485: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.4486: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.4487: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.4488: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.4489: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.4490: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.4491: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.4492: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.4493: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.4494: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.4495: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.4496: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.4497: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.4498: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.4499: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.4500: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.4501: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.4502: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.4503: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.4504: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.4505: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.4506: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.4507: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.4508: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.4509: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.4510: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.4511: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.4512: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.4513: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.4514: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.4515: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.4516: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial
Source.4517: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.4518: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.4519: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.4520: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.4521: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.4522: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.4523: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.4524: DFBPPR15328 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 31
Source.4525: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.4526: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.4527: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.4528: DFBPPR15353 ---- Microorganism protein ---- Pre-mRNA-splicing factor ISY1
Source.4529: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.4530: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.4531: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.4532: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.4533: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.4534: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.4535: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.4536: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.4537: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.4538: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.4539: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.4540: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.4541: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34
Source.4542: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.4543: DFBPPR15437 ---- Microorganism protein ---- Ubiquitin-like-conjugating enzyme ATG10
Source.4544: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.4545: DFBPPR15442 ---- Microorganism protein ---- Type 1 phosphatases regulator YPI1
Source.4546: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.4547: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.4548: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24
Source.4549: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.4550: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.4551: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.4552: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.4553: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.4554: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.4555: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.4556: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.4557: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.4558: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.4559: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.4560: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.4561: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.4562: DFBPPR15528 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC23
Source.4563: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.4564: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.4565: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.4566: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.4567: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.4568: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.4569: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.4570: DFBPPR15559 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC26
Source.4571: DFBPPR15565 ---- Microorganism protein ---- 37S ribosomal protein S10, mitochondrial
Source.4572: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.4573: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.4574: DFBPPR15572 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 2, mitochondrial
Source.4575: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.4576: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1
Source.4577: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.4578: DFBPPR15606 ---- Microorganism protein ---- Assembly factor CBP4
Source.4579: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.4580: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.4581: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.4582: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.4583: DFBPPR15636 ---- Microorganism protein ---- ATP synthase subunit d, mitochondrial
Source.4584: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.4585: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.4586: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.4587: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1
Source.4588: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.4589: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.4590: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.4591: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial
Source.4592: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.4593: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.4594: DFBPPR15737 ---- Microorganism protein ---- Required for respiratory growth protein 9, mitochondrial
Source.4595: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.4596: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1
Source.4597: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial
Source.4598: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.4599: DFBPPR15758 ---- Microorganism protein ---- Required for respiratory growth protein 8, mitochondrial
Source.4600: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.4601: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.4602: DFBPPR15780 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 8
Source.4603: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.4604: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.4605: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.4606: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.4607: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.4608: DFBPPR15841 ---- Microorganism protein ---- Agaricus bisporus lectin
Source.4609: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.4610: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase
Source.4611: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.4612: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.4613: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4614: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.4615: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.4616: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4617: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.4618: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.4619: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4620: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.4621: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4622: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.4623: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4624: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.4625: DFBPPR7812 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.4626: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4627: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.4628: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.4629: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.4630: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.4631: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.4632: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1
Source.4633: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4634: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.4635: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.4636: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1
Source.4637: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.4638: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.4639: DFBPPR7912 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.4640: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4
Source.4641: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.4642: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.4643: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.4644: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.4645: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.4646: DFBPPR7975 ---- Plant protein ---- Protein Ycf2
Source.4647: DFBPPR7985 ---- Plant protein ---- Uncharacterized 9.9 kDa protein
Source.4648: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.4649: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4650: DFBPPR7997 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.4651: DFBPPR8000 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.4652: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.4653: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.4654: DFBPPR8029 ---- Plant protein ---- Vignain
Source.4655: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.4656: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4657: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.4658: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.4659: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.4660: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.4661: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4662: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.4663: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4664: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.4665: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4666: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.4667: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.4668: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.4669: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.4670: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4671: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.4672: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.4673: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.4674: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.4675: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.4676: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.4677: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.4678: DFBPPR8127 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.4679: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4680: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.4681: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.4682: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.4683: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4684: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.4685: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.4686: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.4687: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.4688: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4689: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.4690: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.4691: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3
Source.4692: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.4693: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4694: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4695: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.4696: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4697: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.4698: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.4699: DFBPPR8270 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.4700: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.4701: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.4702: DFBPPR8281 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.4703: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.4704: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.4705: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.4706: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.4707: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.4708: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4709: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Source.4710: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 7580, 8214, 8890, 9477
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214